6-[(8a-Carboxy-4,4,6a,6b,14b-pentamethyl-11-methylidene-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]-3,5-dihydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid
Internal ID | eee0b71b-e95b-434c-a5a9-bd3e78ef0541 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glucuronides > O-glucuronides |
IUPAC Name | 6-[(8a-carboxy-4,4,6a,6b,14b-pentamethyl-11-methylidene-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]-3,5-dihydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(C(O4)C(=O)O)O)OC5C(C(C(CO5)O)O)O)O)C)CC=C6C3(CCC7(C6CC(=C)CC7)C(=O)O)C)C)C |
SMILES (Isomeric) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(C(O4)C(=O)O)O)OC5C(C(C(CO5)O)O)O)O)C)CC=C6C3(CCC7(C6CC(=C)CC7)C(=O)O)C)C)C |
InChI | InChI=1S/C40H60O13/c1-19-9-14-40(35(48)49)16-15-38(5)20(21(40)17-19)7-8-24-37(4)12-11-25(36(2,3)23(37)10-13-39(24,38)6)51-34-29(45)30(28(44)31(53-34)32(46)47)52-33-27(43)26(42)22(41)18-50-33/h7,21-31,33-34,41-45H,1,8-18H2,2-6H3,(H,46,47)(H,48,49) |
InChI Key | JNXHXAHVUZXQNY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H60O13 |
Molecular Weight | 748.90 g/mol |
Exact Mass | 748.40339196 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 3.30 |
6-[(8a-carboxy-4,4,6a,6b,14b-pentamethyl-11-methylidene-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl)oxy]-3,5-dihydroxy-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxane-2-carboxylic acid |
6-[(8a-carboxy-4,4,6a,6b,14b-pentamethyl-11-methylidene-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl)oxy]-3,5-dihydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.18% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.62% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.08% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.95% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.64% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.54% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 85.80% | 97.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.19% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.80% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.36% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.55% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.19% | 92.94% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.04% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anredera baselloides |
PubChem | 73172989 |
LOTUS | LTS0093541 |
wikiData | Q105132168 |