8-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(4-hydroxyphenyl)-4-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-3,4-dihydro-2H-chromene-3,5,7-triol
| Internal ID | c0d52832-27a1-4fb9-95ef-78df576df997 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 8-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(4-hydroxyphenyl)-4-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES (Canonical) | C1C(C2=C(C=C(C=C2)O)OC1C3=CC=C(C=C3)O)C4=C5C(=C(C=C4O)O)C(C(C(O5)C6=CC=C(C=C6)O)O)C7=C(C=C(C8=C7OC(C(C8)O)C9=CC=C(C=C9)O)O)O |
| SMILES (Isomeric) | C1C(C2=C(C=C(C=C2)O)OC1C3=CC=C(C=C3)O)C4=C5C(=C(C=C4O)O)C(C(C(O5)C6=CC=C(C=C6)O)O)C7=C(C=C(C8=C7OC(C(C8)O)C9=CC=C(C=C9)O)O)O |
| InChI | InChI=1S/C45H38O13/c46-23-7-1-20(2-8-23)35-17-28(27-14-13-26(49)15-36(27)56-35)37-31(51)19-33(53)39-40(41(55)43(58-45(37)39)22-5-11-25(48)12-6-22)38-32(52)18-30(50)29-16-34(54)42(57-44(29)38)21-3-9-24(47)10-4-21/h1-15,18-19,28,34-35,40-43,46-55H,16-17H2 |
| InChI Key | FENTTYNAYLMXDB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H38O13 |
| Molecular Weight | 786.80 g/mol |
| Exact Mass | 786.23124126 g/mol |
| Topological Polar Surface Area (TPSA) | 230.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.91% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.53% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.69% | 98.75% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 90.50% | 96.42% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.05% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.29% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.03% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.74% | 94.45% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.18% | 97.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.17% | 95.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.55% | 99.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.33% | 98.95% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.78% | 85.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.75% | 95.93% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.70% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.73% | 86.33% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.64% | 89.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.36% | 99.17% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.33% | 95.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cassia fistula |
| PubChem | 14015931 |
| LOTUS | LTS0127024 |
| wikiData | Q104994073 |