[(2S,3R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4-oxo-2,3-dihydrochromen-3-yl] (Z)-2-methylbut-2-enoate
| Internal ID | 9a6c1f06-6142-4c53-a869-7b56b6eabce9 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
| IUPAC Name | [(2S,3R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4-oxo-2,3-dihydrochromen-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C(OC2=C(C1=O)C(=CC(=C2OC)O)O)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@@H]1[C@@H](OC2=C(C1=O)C(=CC(=C2OC)O)O)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C21H20O8/c1-4-10(2)21(26)29-20-16(25)15-13(23)9-14(24)18(27-3)19(15)28-17(20)11-5-7-12(22)8-6-11/h4-9,17,20,22-24H,1-3H3/b10-4-/t17-,20-/m0/s1 |
| InChI Key | JBNBPQOSXSSECK-QCVRMJSYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.11581759 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of [(2S,3R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4-oxo-2,3-dihydrochromen-3-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/b86eb0e0-83dc-11ee-a0a0-d3ecf08c772c.jpg "2D Structure of [(2S,3R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4-oxo-2,3-dihydrochromen-3-yl] (Z)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.57% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.07% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.04% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.63% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.48% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.91% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.41% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.77% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.65% | 98.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.48% | 91.19% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.90% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.17% | 94.73% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 81.53% | 97.53% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.34% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Geraea canescens |
| PubChem | 162908251 |
| LOTUS | LTS0224465 |
| wikiData | Q105124451 |