[(1S,3S,4R,5S,6S,8S,10S,16S,23S,24R,25R,26R)-5,16-diacetyloxy-4,26-dihydroxy-6-methyl-17,20-dioxo-24-[(E)-3-phenylprop-2-enoyl]oxy-10-propyl-2,7,9,21,27-pentaoxatricyclo[21.3.1.03,8]heptacosan-25-yl] (Z)-2-methylbut-2-enoate
Internal ID | a8270cf6-8b16-4237-8597-1bd07d742b02 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(1S,3S,4R,5S,6S,8S,10S,16S,23S,24R,25R,26R)-5,16-diacetyloxy-4,26-dihydroxy-6-methyl-17,20-dioxo-24-[(E)-3-phenylprop-2-enoyl]oxy-10-propyl-2,7,9,21,27-pentaoxatricyclo[21.3.1.03,8]heptacosan-25-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CCCC1CCCCCC(C(=O)CCC(=O)OCC2C(C(C(C(O2)OC3C(C(C(OC3O1)C)OC(=O)C)O)O)OC(=O)C(=CC)C)OC(=O)C=CC4=CC=CC=C4)OC(=O)C |
SMILES (Isomeric) | CCC[C@H]1CCCCC[C@@H](C(=O)CCC(=O)OC[C@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@H]3[C@@H]([C@@H]([C@@H](O[C@@H]3O1)C)OC(=O)C)O)O)OC(=O)/C(=C\C)/C)OC(=O)/C=C/C4=CC=CC=C4)OC(=O)C |
InChI | InChI=1S/C44H60O17/c1-7-15-30-18-13-10-14-19-32(55-27(5)45)31(47)21-23-34(48)53-24-33-39(59-35(49)22-20-29-16-11-9-12-17-29)40(60-42(52)25(3)8-2)37(51)43(58-33)61-41-36(50)38(56-28(6)46)26(4)54-44(41)57-30/h8-9,11-12,16-17,20,22,26,30,32-33,36-41,43-44,50-51H,7,10,13-15,18-19,21,23-24H2,1-6H3/b22-20+,25-8-/t26-,30-,32-,33-,36+,37+,38+,39+,40+,41-,43-,44+/m0/s1 |
InChI Key | RGCFRCYTLQGODZ-RXAQKUPJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H60O17 |
Molecular Weight | 860.90 g/mol |
Exact Mass | 860.38305044 g/mol |
Topological Polar Surface Area (TPSA) | 226.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of [(1S,3S,4R,5S,6S,8S,10S,16S,23S,24R,25R,26R)-5,16-diacetyloxy-4,26-dihydroxy-6-methyl-17,20-dioxo-24-[(E)-3-phenylprop-2-enoyl]oxy-10-propyl-2,7,9,21,27-pentaoxatricyclo[21.3.1.03,8]heptacosan-25-yl] (Z)-2-methylbut-2-enoate 2D Structure of [(1S,3S,4R,5S,6S,8S,10S,16S,23S,24R,25R,26R)-5,16-diacetyloxy-4,26-dihydroxy-6-methyl-17,20-dioxo-24-[(E)-3-phenylprop-2-enoyl]oxy-10-propyl-2,7,9,21,27-pentaoxatricyclo[21.3.1.03,8]heptacosan-25-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/b8256e60-85f3-11ee-89bb-9ff918bb17de.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.81% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.03% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.91% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.65% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.15% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.72% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.51% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.90% | 99.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.92% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.49% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.79% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.55% | 93.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.11% | 83.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.51% | 93.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.46% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.14% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.57% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea squamosa |
PubChem | 102397823 |
LOTUS | LTS0235298 |
wikiData | Q105235763 |