[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1R,3R,5S,8S,9S,10S,13S,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]oxan-2-yl]methyl acetate
Internal ID | de2e36d1-9bc5-465d-bfb1-744535606e66 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1R,3R,5S,8S,9S,10S,13S,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]oxan-2-yl]methyl acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC(CC3C2(C4CCC5(C(C4CC3)CC(C5C(C)C(CCC(C)C)O)OC6C(C(C(C(O6)COC(=O)C)O)O)O)C)C)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2C[C@@H](C[C@H]3[C@]2([C@H]4CC[C@]5([C@H]([C@@H]4CC3)C[C@@H]([C@@H]5[C@H](C)[C@H](CCC(C)C)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)COC(=O)C)O)O)O)C)C)O)O)O)O |
InChI | InChI=1S/C41H70O14/c1-18(2)8-11-27(44)19(3)31-28(53-39-37(50)35(48)33(46)29(54-39)17-51-21(5)42)16-26-24-10-9-22-14-23(43)15-30(41(22,7)25(24)12-13-40(26,31)6)55-38-36(49)34(47)32(45)20(4)52-38/h18-20,22-39,43-50H,8-17H2,1-7H3/t19-,20+,22+,23-,24-,25+,26+,27+,28+,29-,30-,31+,32+,33-,34-,35+,36-,37-,38+,39-,40+,41+/m1/s1 |
InChI Key | RBLLNRNEIRIXEX-JQFDXAHESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C41H70O14 |
Molecular Weight | 787.00 g/mol |
Exact Mass | 786.47655690 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1R,3R,5S,8S,9S,10S,13S,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]oxan-2-yl]methyl acetate 2D Structure of [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(1R,3R,5S,8S,9S,10S,13S,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]oxan-2-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/b805b4a0-8534-11ee-a1ab-a94a5df0a0a9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.18% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.45% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.46% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.01% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.55% | 97.09% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.50% | 98.05% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 91.82% | 99.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.20% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.77% | 89.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.68% | 98.10% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.19% | 96.38% |
CHEMBL2581 | P07339 | Cathepsin D | 90.01% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.54% | 85.14% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.46% | 100.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 88.91% | 85.31% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.44% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.18% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.82% | 95.93% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.19% | 90.17% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.33% | 97.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.25% | 94.45% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.12% | 89.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.72% | 93.04% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.68% | 89.05% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.44% | 95.58% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.17% | 92.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.92% | 82.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.34% | 91.19% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.70% | 92.78% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.19% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum thyrsoides |
PubChem | 44575748 |
LOTUS | LTS0131487 |
wikiData | Q105233170 |