2-[[21-[6-[[3,4,5,13,21,22,23-Heptahydroxy-8,18-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl]oxycarbonyl]-2,3,4-trihydroxyphenoxy]-1,2,2,14,15,16,19,35,36-nonahydroxy-3,6,11,24,32-pentaoxo-29-(3,4,5-trihydroxybenzoyl)oxy-7,10,25,28,31,40-hexaoxaoctacyclo[35.2.1.05,39.08,27.09,30.012,17.018,23.033,38]tetraconta-4,12,14,16,18,20,22,33,35,37-decaen-20-yl]oxy]-3,4,5-trihydroxybenzoic acid
| Internal ID | 6c97320e-d005-4fe0-9526-f30bc5174cfa |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | 2-[[21-[6-[[3,4,5,13,21,22,23-heptahydroxy-8,18-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl]oxycarbonyl]-2,3,4-trihydroxyphenoxy]-1,2,2,14,15,16,19,35,36-nonahydroxy-3,6,11,24,32-pentaoxo-29-(3,4,5-trihydroxybenzoyl)oxy-7,10,25,28,31,40-hexaoxaoctacyclo[35.2.1.05,39.08,27.09,30.012,17.018,23.033,38]tetraconta-4,12,14,16,18,20,22,33,35,37-decaen-20-yl]oxy]-3,4,5-trihydroxybenzoic acid |
| SMILES (Canonical) | C1C2C(C(C(C(O2)O)OC(=O)C3=CC(=C(C(=C3OC4=C(C(=C5C(=C4)C(=O)OCC6C7C(C(C(O6)OC(=O)C8=CC(=C(C(=C8)O)O)O)OC(=O)C9=CC(=C(C2=C9C3C(=CC(=O)C(C3(O2)O)(O)O)C(=O)O7)O)O)OC(=O)C2=CC(=C(C(=C25)O)O)O)O)OC2=C(C(=C(C=C2C(=O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
| SMILES (Isomeric) | C1C2C(C(C(C(O2)O)OC(=O)C3=CC(=C(C(=C3OC4=C(C(=C5C(=C4)C(=O)OCC6C7C(C(C(O6)OC(=O)C8=CC(=C(C(=C8)O)O)O)OC(=O)C9=CC(=C(C2=C9C3C(=CC(=O)C(C3(O2)O)(O)O)C(=O)O7)O)O)OC(=O)C2=CC(=C(C(=C25)O)O)O)O)OC2=C(C(=C(C=C2C(=O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
| InChI | InChI=1S/C82H56O54/c83-25-1-15(2-26(84)45(25)94)70(110)131-65-62-36(13-123-72(112)17-5-29(87)47(96)53(102)39(17)40-18(74(114)129-62)6-30(88)48(97)54(40)103)126-79(119)67(65)133-78(118)24-10-33(91)51(100)58(107)60(24)125-35-11-21-42(56(105)61(35)128-59-23(69(108)109)9-32(90)50(99)57(59)106)41-19(7-31(89)49(98)55(41)104)75(115)132-66-63-37(14-124-73(21)113)127-80(135-71(111)16-3-27(85)46(95)28(86)4-16)68(66)134-76(116)20-8-34(92)52(101)64-43(20)44-22(77(117)130-63)12-38(93)81(120,121)82(44,122)136-64/h1-12,36-37,44,62-63,65-68,79-80,83-92,94-107,119-122H,13-14H2,(H,108,109) |
| InChI Key | UWBHWQHXIPEGRK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C82H56O54 |
| Molecular Weight | 1905.30 g/mol |
| Exact Mass | 1904.1635912 g/mol |
| Topological Polar Surface Area (TPSA) | 904.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.36% | 95.17% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 97.59% | 83.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.31% | 91.49% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 95.81% | 94.42% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.57% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.75% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.12% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.64% | 94.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.18% | 97.21% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.00% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 87.89% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.34% | 98.95% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.15% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.94% | 99.17% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.64% | 96.38% |
| CHEMBL3572 | P11597 | Cholesteryl ester transfer protein | 85.08% | 92.67% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.03% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.24% | 97.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.79% | 95.50% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.89% | 95.78% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.40% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.35% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.92% | 92.62% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.69% | 94.45% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.20% | 92.50% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.15% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Excoecaria kawakamii |
| PubChem | 163027432 |
| LOTUS | LTS0079103 |
| wikiData | Q105280254 |