[2,5-Bis(4-hydroxyphenyl)-3,4,6-tris[3-(3-methyloxiran-2-yl)prop-2-enoyloxy]phenyl] 3-(3-methyloxiran-2-yl)prop-2-enoate
| Internal ID | 6010e56a-cf0d-40d0-a0dc-aaa96ef517f6 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Terphenyls > P-terphenyls |
| IUPAC Name | [2,5-bis(4-hydroxyphenyl)-3,4,6-tris[3-(3-methyloxiran-2-yl)prop-2-enoyloxy]phenyl] 3-(3-methyloxiran-2-yl)prop-2-enoate |
| SMILES (Canonical) | CC1C(O1)C=CC(=O)OC2=C(C(=C(C(=C2OC(=O)C=CC3C(O3)C)C4=CC=C(C=C4)O)OC(=O)C=CC5C(O5)C)OC(=O)C=CC6C(O6)C)C7=CC=C(C=C7)O |
| SMILES (Isomeric) | CC1C(O1)C=CC(=O)OC2=C(C(=C(C(=C2OC(=O)C=CC3C(O3)C)C4=CC=C(C=C4)O)OC(=O)C=CC5C(O5)C)OC(=O)C=CC6C(O6)C)C7=CC=C(C=C7)O |
| InChI | InChI=1S/C42H38O14/c1-21-29(49-21)13-17-33(45)53-39-37(25-5-9-27(43)10-6-25)41(55-35(47)19-15-31-23(3)51-31)42(56-36(48)20-16-32-24(4)52-32)38(26-7-11-28(44)12-8-26)40(39)54-34(46)18-14-30-22(2)50-30/h5-24,29-32,43-44H,1-4H3 |
| InChI Key | KGWRAUIBLVGBPO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H38O14 |
| Molecular Weight | 766.70 g/mol |
| Exact Mass | 766.22615588 g/mol |
| Topological Polar Surface Area (TPSA) | 196.00 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.31% | 91.11% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.73% | 95.64% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.33% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.17% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.14% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.07% | 89.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.34% | 98.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.77% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.00% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.37% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.33% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.43% | 93.10% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.11% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.83% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85124933 |
| LOTUS | LTS0045697 |
| wikiData | Q105141013 |