(3S,4S,6E,9R,10E)-3,9-dihydroxy-N-[(2R,3S)-2-hydroxy-4-[3-[(2R,3S,6S,8S)-8-[(E,3S,6S)-6-hydroxy-3,5-dimethylhept-4-enyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]propylamino]-3-methyl-4-oxobutyl]-4-methyldodeca-6,10-dienamide
| Internal ID | 36b4b6a6-e092-4bbf-b6d9-030cc37cce75 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Acetals > Ketals |
| IUPAC Name | (3S,4S,6E,9R,10E)-3,9-dihydroxy-N-[(2R,3S)-2-hydroxy-4-[3-[(2R,3S,6S,8S)-8-[(E,3S,6S)-6-hydroxy-3,5-dimethylhept-4-enyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]propylamino]-3-methyl-4-oxobutyl]-4-methyldodeca-6,10-dienamide |
| SMILES (Canonical) | CC=CC(CC=CCC(C)C(CC(=O)NCC(C(C)C(=O)NCCCC1C(CCC2(O1)CCCC(O2)CCC(C)C=C(C)C(C)O)C)O)O)O |
| SMILES (Isomeric) | C/C=C/[C@@H](C/C=C/C[C@H](C)[C@H](CC(=O)NC[C@@H]([C@H](C)C(=O)NCCC[C@@H]1[C@H](CC[C@@]2(O1)CCC[C@H](O2)CC[C@H](C)/C=C(\C)/[C@H](C)O)C)O)O)O |
| InChI | InChI=1S/C40H70N2O8/c1-8-13-33(44)15-10-9-14-28(3)35(45)25-38(47)42-26-36(46)31(6)39(48)41-23-12-17-37-29(4)20-22-40(50-37)21-11-16-34(49-40)19-18-27(2)24-30(5)32(7)43/h8-10,13,24,27-29,31-37,43-46H,11-12,14-23,25-26H2,1-7H3,(H,41,48)(H,42,47)/b10-9+,13-8+,30-24+/t27-,28-,29-,31-,32-,33-,34-,35-,36-,37+,40-/m0/s1 |
| InChI Key | VBQUNUFYTUOFSU-JBBCPXDWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C40H70N2O8 |
| Molecular Weight | 707.00 g/mol |
| Exact Mass | 706.51321720 g/mol |
| Topological Polar Surface Area (TPSA) | 158.00 Ų |
| XlogP | 5.10 |
| Atomic LogP (AlogP) | 5.48 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 21 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.8135 | 81.35% |
| Caco-2 | - | 0.8605 | 86.05% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.7469 | 74.69% |
| OATP2B1 inhibitior | - | 0.7203 | 72.03% |
| OATP1B1 inhibitior | + | 0.8246 | 82.46% |
| OATP1B3 inhibitior | + | 0.9229 | 92.29% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9195 | 91.95% |
| P-glycoprotein inhibitior | + | 0.7273 | 72.73% |
| P-glycoprotein substrate | + | 0.7225 | 72.25% |
| CYP3A4 substrate | + | 0.7275 | 72.75% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8503 | 85.03% |
| CYP3A4 inhibition | - | 0.7903 | 79.03% |
| CYP2C9 inhibition | - | 0.8926 | 89.26% |
| CYP2C19 inhibition | - | 0.8572 | 85.72% |
| CYP2D6 inhibition | - | 0.9119 | 91.19% |
| CYP1A2 inhibition | - | 0.8891 | 88.91% |
| CYP2C8 inhibition | + | 0.6881 | 68.81% |
| CYP inhibitory promiscuity | - | 0.9542 | 95.42% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.5732 | 57.32% |
| Eye corrosion | - | 0.9874 | 98.74% |
| Eye irritation | - | 0.9171 | 91.71% |
| Skin irritation | - | 0.7611 | 76.11% |
| Skin corrosion | - | 0.9387 | 93.87% |
| Ames mutagenesis | - | 0.5919 | 59.19% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6949 | 69.49% |
| Micronuclear | + | 0.6700 | 67.00% |
| Hepatotoxicity | - | 0.5675 | 56.75% |
| skin sensitisation | - | 0.8621 | 86.21% |
| Respiratory toxicity | - | 0.5444 | 54.44% |
| Reproductive toxicity | + | 0.7333 | 73.33% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.7589 | 75.89% |
| Acute Oral Toxicity (c) | III | 0.6291 | 62.91% |
| Estrogen receptor binding | + | 0.8018 | 80.18% |
| Androgen receptor binding | + | 0.6489 | 64.89% |
| Thyroid receptor binding | - | 0.5285 | 52.85% |
| Glucocorticoid receptor binding | + | 0.7164 | 71.64% |
| Aromatase binding | + | 0.6364 | 63.64% |
| PPAR gamma | + | 0.7197 | 71.97% |
| Honey bee toxicity | - | 0.7172 | 71.72% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.8099 | 80.99% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.98% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.28% | 98.05% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.55% | 95.58% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 92.67% | 98.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.65% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.79% | 94.45% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 91.55% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.24% | 97.09% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 91.20% | 85.31% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.64% | 95.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.51% | 91.19% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.20% | 97.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.96% | 92.88% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 88.34% | 96.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.15% | 96.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.12% | 95.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.39% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 87.23% | 98.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.50% | 90.08% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.40% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.24% | 99.23% |
| CHEMBL3785 | Q8TDS4 | Hydroxycarboxylic acid receptor 2 | 85.63% | 94.05% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.54% | 97.25% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.45% | 96.21% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.44% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.44% | 97.14% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 85.30% | 89.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.07% | 99.17% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.04% | 96.61% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.41% | 89.00% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 84.37% | 93.33% |
| CHEMBL4801 | P29466 | Caspase-1 | 83.94% | 96.85% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.94% | 94.73% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.79% | 89.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.48% | 94.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.11% | 95.89% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 83.05% | 96.28% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 82.97% | 97.34% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.90% | 91.24% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.51% | 98.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.34% | 90.71% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.19% | 96.67% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.92% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.59% | 96.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.59% | 97.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.08% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101676766 |
| LOTUS | LTS0150686 |
| wikiData | Q105283444 |