methyl 2-[(1S,2R,3R,4R,11R,15R,16R,17R,18S,32R,34S,35S)-2,16,17,35-tetraacetyloxy-34-hydroxy-7,21,22,32,34-pentamethyl-6,10,12,20,29-pentaoxo-5,13,19,30,33-pentaoxa-24-azahexacyclo[16.15.1.14,15.01,15.03,32.023,28]pentatriaconta-23(28),24,26-trien-11-yl]acetate
Internal ID | c7085863-1770-4d3e-ae7e-fbfdd5be0a14 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | methyl 2-[(1S,2R,3R,4R,11R,15R,16R,17R,18S,32R,34S,35S)-2,16,17,35-tetraacetyloxy-34-hydroxy-7,21,22,32,34-pentamethyl-6,10,12,20,29-pentaoxo-5,13,19,30,33-pentaoxa-24-azahexacyclo[16.15.1.14,15.01,15.03,32.023,28]pentatriaconta-23(28),24,26-trien-11-yl]acetate |
SMILES (Canonical) | CC1CCC(=O)C(C(=O)OCC23C(C(C4C(C25C(C(C(C3OC(=O)C)OC(=O)C)OC(=O)C(C(C6=C(C=CC=N6)C(=O)OCC4(O5)C)C)C)(C)O)OC(=O)C)OC1=O)OC(=O)C)CC(=O)OC |
SMILES (Isomeric) | CC1CCC(=O)[C@H](C(=O)OC[C@]23[C@@H]([C@@H]([C@@H]4[C@H]([C@]25[C@@]([C@H]([C@@H]([C@@H]3OC(=O)C)OC(=O)C)OC(=O)C(C(C6=C(C=CC=N6)C(=O)OC[C@@]4(O5)C)C)C)(C)O)OC(=O)C)OC1=O)OC(=O)C)CC(=O)OC |
InChI | InChI=1S/C45H55NO21/c1-19-13-14-28(51)27(16-29(52)58-10)41(56)60-18-44-36(63-24(6)49)32(65-38(19)53)30-34(62-23(5)48)45(44)43(9,57)35(33(61-22(4)47)37(44)64-25(7)50)66-39(54)21(3)20(2)31-26(12-11-15-46-31)40(55)59-17-42(30,8)67-45/h11-12,15,19-21,27,30,32-37,57H,13-14,16-18H2,1-10H3/t19?,20?,21?,27-,30-,32-,33+,34-,35+,36-,37+,42+,43+,44-,45+/m1/s1 |
InChI Key | GHLDKPNDMMVFDQ-GJHVNUGQSA-N |
Popularity | 3 references in papers |
Molecular Formula | C45H55NO21 |
Molecular Weight | 945.90 g/mol |
Exact Mass | 945.32665776 g/mol |
Topological Polar Surface Area (TPSA) | 296.00 Ų |
XlogP | 0.90 |
CHEMBL505429 |
![2D Structure of methyl 2-[(1S,2R,3R,4R,11R,15R,16R,17R,18S,32R,34S,35S)-2,16,17,35-tetraacetyloxy-34-hydroxy-7,21,22,32,34-pentamethyl-6,10,12,20,29-pentaoxo-5,13,19,30,33-pentaoxa-24-azahexacyclo[16.15.1.14,15.01,15.03,32.023,28]pentatriaconta-23(28),24,26-trien-11-yl]acetate 2D Structure of methyl 2-[(1S,2R,3R,4R,11R,15R,16R,17R,18S,32R,34S,35S)-2,16,17,35-tetraacetyloxy-34-hydroxy-7,21,22,32,34-pentamethyl-6,10,12,20,29-pentaoxo-5,13,19,30,33-pentaoxa-24-azahexacyclo[16.15.1.14,15.01,15.03,32.023,28]pentatriaconta-23(28),24,26-trien-11-yl]acetate](https://plantaedb.com/storage/docs/compounds/2023/11/b67555c0-8691-11ee-ba1c-b14b0ff491b7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.72% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.64% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.41% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.33% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.10% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.37% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.22% | 95.56% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.84% | 81.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.41% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.34% | 83.82% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.12% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.07% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.00% | 97.25% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.18% | 96.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.99% | 82.69% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.86% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.13% | 96.77% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.88% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.42% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.25% | 94.80% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.82% | 96.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.71% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 81.65% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.59% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.53% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.14% | 89.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.07% | 93.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.06% | 91.24% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.05% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.58% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tripterygium wilfordii |
PubChem | 44583766 |
LOTUS | LTS0090930 |
wikiData | Q105008598 |