7-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxychromen-4-one
Internal ID | d4f09f25-e21f-470e-981f-bcd18960812e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OCC3C(C(C(C(O3)OC4=CC(=C5C(=C4)OC(=C(C5=O)OC)C6=CC(=C(C=C6)OC)O)O)O)O)O)C)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@@H]([C@H]([C@@H](O[C@H]2OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC4=CC(=C5C(=C4)OC(=C(C5=O)OC)C6=CC(=C(C=C6)OC)O)O)O)O)O)C)O)O)O)O)O |
InChI | InChI=1S/C35H44O20/c1-11-21(38)25(42)28(45)33(50-11)55-32-27(44)22(39)12(2)51-35(32)49-10-19-23(40)26(43)29(46)34(54-19)52-14-8-16(37)20-18(9-14)53-30(31(48-4)24(20)41)13-5-6-17(47-3)15(36)7-13/h5-9,11-12,19,21-23,25-29,32-40,42-46H,10H2,1-4H3/t11-,12-,19+,21-,22-,23+,25+,26-,27+,28+,29+,32+,33-,34+,35+/m0/s1 |
InChI Key | HNKHXYXGMFUHCQ-IGBOVQOXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H44O20 |
Molecular Weight | 784.70 g/mol |
Exact Mass | 784.24259379 g/mol |
Topological Polar Surface Area (TPSA) | 302.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.85% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.48% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.30% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.27% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.97% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.59% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.07% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.59% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.48% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.46% | 95.78% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.57% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.82% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.63% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.09% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.33% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.63% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 82.72% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.29% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.84% | 97.09% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.37% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bidens pilosa |
Erythrina crista-galli |
PubChem | 10629072 |
LOTUS | LTS0180548 |
wikiData | Q105181237 |