Methyl 3,4,5-trihydroxy-6-[[8-hydroxy-8a-[5-hydroxy-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxycarbonyl-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]oxane-2-carboxylate
| Internal ID | 8cf4ec9a-6cf0-4068-bcf2-c439246a83f5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | methyl 3,4,5-trihydroxy-6-[[8-hydroxy-8a-[5-hydroxy-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxycarbonyl-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]oxane-2-carboxylate |
| SMILES (Canonical) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)OC)O)O)O)C)C(=O)OC7C(C(C(CO7)O)OC8C(C(C(C(O8)CO)O)O)O)OC(=O)C=CC9=CC=C(C=C9)O)C |
| SMILES (Isomeric) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)OC)O)O)O)C)C(=O)OC7C(C(C(CO7)O)OC8C(C(C(C(O8)CO)O)O)O)OC(=O)C=CC9=CC=C(C=C9)O)C |
| InChI | InChI=1S/C57H82O21/c1-52(2)21-22-57(51(70)78-50-46(75-37(62)16-11-27-9-12-28(59)13-10-27)44(31(60)26-72-50)76-48-42(67)39(64)38(63)32(25-58)73-48)30(23-52)29-14-15-34-54(5)19-18-36(74-49-43(68)40(65)41(66)45(77-49)47(69)71-8)53(3,4)33(54)17-20-55(34,6)56(29,7)24-35(57)61/h9-14,16,30-36,38-46,48-50,58-61,63-68H,15,17-26H2,1-8H3 |
| InChI Key | OEXIAAITFXCTKI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C57H82O21 |
| Molecular Weight | 1103.20 g/mol |
| Exact Mass | 1102.53485962 g/mol |
| Topological Polar Surface Area (TPSA) | 327.00 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.05% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.07% | 86.33% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 94.49% | 89.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.46% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.49% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.05% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.58% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.39% | 94.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.29% | 99.17% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.12% | 89.44% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.83% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.23% | 96.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.42% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.29% | 98.95% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 83.08% | 97.64% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.88% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.77% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 81.08% | 97.50% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.71% | 89.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.39% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tragopogon porrifolius |
| PubChem | 73813230 |
| LOTUS | LTS0123362 |
| wikiData | Q105190641 |