4H-1-Benzopyran-4-one, 3-(2,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-8-(4-hydroxy-3-methyl-2-butenyl)-
Internal ID | 5f1afa75-e6de-415e-aeb9-6b19979a1c62 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 8-prenylated isoflavanones |
IUPAC Name | 3-(2,4-dihydroxyphenyl)-7-hydroxy-8-(4-hydroxy-3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1OCC(C2=O)C3=C(C=C(C=C3)O)O)O)CO |
SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1OCC(C2=O)C3=C(C=C(C=C3)O)O)O)CO |
InChI | InChI=1S/C20H20O6/c1-11(9-21)2-4-14-17(23)7-6-15-19(25)16(10-26-20(14)15)13-5-3-12(22)8-18(13)24/h2-3,5-8,16,21-24H,4,9-10H2,1H3 |
InChI Key | VPCRIHAWNUNORJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O6 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 2.70 |
104380-54-3 |
4H-1-Benzopyran-4-one, 3-(2,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-8-(4-hydroxy-3-methyl-2-butenyl)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.60% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.11% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.02% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.00% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.37% | 93.40% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.08% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.24% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.03% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.71% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.28% | 95.93% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.13% | 99.17% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.05% | 96.12% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.94% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.58% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.52% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.30% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 80.90% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phaseolus lunatus |
PubChem | 74977372 |
LOTUS | LTS0247002 |
wikiData | Q105290648 |