19-Hydroxy-2,7,7,13,18,21-hexamethyl-6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-5,17-dione
| Internal ID | b085fa35-402e-4626-a5b3-83500e324efb |
| Taxonomy | Organoheterocyclic compounds > Furopyrans |
| IUPAC Name | 19-hydroxy-2,7,7,13,18,21-hexamethyl-6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-5,17-dione |
| SMILES (Canonical) | CC1C2CC3(C(=O)OC4C3(C5=C(C(O4)C)OC(C25C)C=C6C1=CC(=O)OC6(C)C)O)C |
| SMILES (Isomeric) | CC1C2CC3(C(=O)OC4C3(C5=C(C(O4)C)OC(C25C)C=C6C1=CC(=O)OC6(C)C)O)C |
| InChI | InChI=1S/C24H28O7/c1-10-12-7-16(25)31-21(3,4)13(12)8-15-23(6)14(10)9-22(5)19(26)30-20-24(22,27)18(23)17(29-15)11(2)28-20/h7-8,10-11,14-15,20,27H,9H2,1-6H3 |
| InChI Key | DIPUOHVSHWSKHT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 91.30 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of 19-Hydroxy-2,7,7,13,18,21-hexamethyl-6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-5,17-dione](https://plantaedb.com/storage/docs/compounds/2023/11/b5f1d7c0-8581-11ee-b393-cf9c1add0c49.jpg "2D Structure of 19-Hydroxy-2,7,7,13,18,21-hexamethyl-6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-5,17-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.92% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.62% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.79% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.22% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.94% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.89% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.45% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.33% | 100.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.73% | 94.78% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.36% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.82% | 96.77% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.02% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163047904 |
| LOTUS | LTS0071092 |
| wikiData | Q103818426 |