2-[2-[[14,22-Dihydroxy-21-(2-hydroxypropan-2-yl)-1,3,12,12,17-pentamethyl-20,24-dioxaheptacyclo[19.2.1.02,19.03,17.06,8.06,16.08,13]tetracosan-11-yl]oxy]-4,5-dihydroxyoxan-3-yl]oxyoxane-3,4,5-triol
| Internal ID | 51ad68ae-046d-4529-87e8-53964cd1692a |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | 2-[2-[[14,22-dihydroxy-21-(2-hydroxypropan-2-yl)-1,3,12,12,17-pentamethyl-20,24-dioxaheptacyclo[19.2.1.02,19.03,17.06,8.06,16.08,13]tetracosan-11-yl]oxy]-4,5-dihydroxyoxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES (Canonical) | CC1(C(CCC23C1C(CC4C2(C3)CCC5(C4(CC6C5C7(CC(C(O6)(O7)C(C)(C)O)O)C)C)C)O)OC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)C |
| SMILES (Isomeric) | CC1(C(CCC23C1C(CC4C2(C3)CCC5(C4(CC6C5C7(CC(C(O6)(O7)C(C)(C)O)O)C)C)C)O)OC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)C |
| InChI | InChI=1S/C40H64O14/c1-33(2)24(51-32-28(26(46)20(43)16-50-32)52-31-27(47)25(45)19(42)15-49-31)8-9-39-17-38(39)11-10-35(5)30-21(13-36(35,6)22(38)12-18(41)29(33)39)53-40(34(3,4)48)23(44)14-37(30,7)54-40/h18-32,41-48H,8-17H2,1-7H3 |
| InChI Key | GQHWHWWRHITXBS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H64O14 |
| Molecular Weight | 768.90 g/mol |
| Exact Mass | 768.42960671 g/mol |
| Topological Polar Surface Area (TPSA) | 217.00 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.05% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.85% | 96.09% |
| CHEMBL204 | P00734 | Thrombin | 92.66% | 96.01% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.28% | 91.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.37% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.47% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.74% | 95.38% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 88.69% | 100.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.65% | 95.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.93% | 96.61% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.59% | 96.77% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.47% | 82.69% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.38% | 96.43% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.09% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.69% | 95.89% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.62% | 92.88% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.13% | 95.58% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.02% | 90.24% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 85.34% | 98.99% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.34% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.18% | 91.07% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.67% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.52% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.28% | 89.00% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 82.59% | 94.01% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.56% | 97.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.54% | 95.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.84% | 95.71% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.10% | 95.92% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.41% | 86.33% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.09% | 94.78% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.03% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus pendulus |
| PubChem | 163044203 |
| LOTUS | LTS0200843 |
| wikiData | Q105015393 |