[2-Hydroxy-4-(3-hydroxy-3-methylpent-4-enyl)-3,4,8,8-tetramethyl-1,2,3,5,6,7-hexahydronaphthalen-1-yl] acetate
Internal ID | 0a50a6d7-e0f2-4c88-aa6e-b06f3f28fd4e |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Tertiary alcohols |
IUPAC Name | [2-hydroxy-4-(3-hydroxy-3-methylpent-4-enyl)-3,4,8,8-tetramethyl-1,2,3,5,6,7-hexahydronaphthalen-1-yl] acetate |
SMILES (Canonical) | CC1C(C(C2=C(C1(C)CCC(C)(C=C)O)CCCC2(C)C)OC(=O)C)O |
SMILES (Isomeric) | CC1C(C(C2=C(C1(C)CCC(C)(C=C)O)CCCC2(C)C)OC(=O)C)O |
InChI | InChI=1S/C22H36O4/c1-8-21(6,25)12-13-22(7)14(2)18(24)19(26-15(3)23)17-16(22)10-9-11-20(17,4)5/h8,14,18-19,24-25H,1,9-13H2,2-7H3 |
InChI Key | HEUKTFJGHNRGIR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H36O4 |
Molecular Weight | 364.50 g/mol |
Exact Mass | 364.26135963 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of [2-Hydroxy-4-(3-hydroxy-3-methylpent-4-enyl)-3,4,8,8-tetramethyl-1,2,3,5,6,7-hexahydronaphthalen-1-yl] acetate 2D Structure of [2-Hydroxy-4-(3-hydroxy-3-methylpent-4-enyl)-3,4,8,8-tetramethyl-1,2,3,5,6,7-hexahydronaphthalen-1-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/b5d82730-85d3-11ee-9b3b-338b9d82d769.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.29% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.25% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.53% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.96% | 91.07% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.32% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.08% | 97.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.45% | 90.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.34% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.33% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 83.29% | 97.50% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.19% | 94.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.08% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.84% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.22% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.86% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.45% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.39% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.74% | 91.24% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.25% | 96.77% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.23% | 94.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.02% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitex trifolia |
PubChem | 85413919 |
LOTUS | LTS0127900 |
wikiData | Q105027049 |