3-[4-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one
Internal ID | 919337df-f193-484f-8036-4f7e166b29c0 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 3-[4-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one |
SMILES (Canonical) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)OC3C(C(CO3)(CO)O)O)OC)C4C5COC(=O)C5CO4 |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)OC3C(C(CO3)(CO)O)O)OC)C4C5COC(=O)C5CO4 |
InChI | InChI=1S/C25H34O15/c1-33-13-3-10(18-11-6-36-22(31)12(11)7-35-18)4-14(34-2)19(13)39-23-20(17(29)16(28)15(5-26)38-23)40-24-21(30)25(32,8-27)9-37-24/h3-4,11-12,15-18,20-21,23-24,26-30,32H,5-9H2,1-2H3 |
InChI Key | GSCMIJSOKLPTFF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H34O15 |
Molecular Weight | 574.50 g/mol |
Exact Mass | 574.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 212.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of 3-[4-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one 2D Structure of 3-[4-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/b5d6e300-85ef-11ee-8da1-69c826358b0d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.81% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.84% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.33% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.66% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.92% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.73% | 86.92% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.37% | 94.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.91% | 92.98% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.88% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 91.92% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.59% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.13% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.07% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.70% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.52% | 97.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.81% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.12% | 95.89% |
CHEMBL220 | P22303 | Acetylcholinesterase | 84.22% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.16% | 99.23% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.12% | 95.83% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.80% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.79% | 97.36% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.46% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
PubChem | 162955828 |
LOTUS | LTS0260414 |
wikiData | Q105017031 |