[(2S,3R,4S,5R,6S)-6-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate
Internal ID | e7886e8a-eae8-448d-bb6b-7bcf6e991a6b |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(2S,3R,4S,5R,6S)-6-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C=C3C4=C2OC(=O)C5=CC(=C(C(=C54)OC3=O)OC)O)O)O)O)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C=C3C4=C2OC(=O)C5=CC(=C(C(=C54)OC3=O)OC)O)O)O)O)OC(=O)C |
InChI | InChI=1S/C23H20O13/c1-6-16(33-7(2)24)14(27)15(28)23(32-6)36-18-11(26)5-9-13-12-8(22(30)35-20(13)18)4-10(25)17(31-3)19(12)34-21(9)29/h4-6,14-16,23,25-28H,1-3H3/t6-,14-,15+,16-,23-/m0/s1 |
InChI Key | BQACUXSQZVEJCN-FGSIAWKFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H20O13 |
Molecular Weight | 504.40 g/mol |
Exact Mass | 504.09039069 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5R,6S)-6-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate 2D Structure of [(2S,3R,4S,5R,6S)-6-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/b5d1f230-82fb-11ee-97d7-89a34710da2b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.94% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.03% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.49% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 92.38% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.76% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.97% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.79% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.42% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.59% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.57% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.52% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 81.35% | 98.75% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.50% | 94.42% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.26% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 5319604 |
LOTUS | LTS0183393 |
wikiData | Q104944235 |