2-(4-Hydroxyphenyl)-5,7-dihydroxy-6-[2-hydroxy-5-(4-oxo-5,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-2-yl)phenyl]-4H-1-benzopyran-4-one
Internal ID | 6384eab7-f8f4-48e4-a8b2-51bf2feec22a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 6-[5-(5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC=C(C=C6)O)O |
SMILES (Isomeric) | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC=C(C=C6)O)O |
InChI | InChI=1S/C30H20O10/c31-15-4-1-13(2-5-15)23-11-22(37)29-26(39-23)12-20(35)27(30(29)38)17-7-14(3-6-18(17)33)24-10-21(36)28-19(34)8-16(32)9-25(28)40-24/h1-9,11-12,24,31-35,38H,10H2 |
InChI Key | XUAORUWVUTVEEC-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H20O10 |
Molecular Weight | 540.50 g/mol |
Exact Mass | 540.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 4.80 |
CHEMBL2253314 |
2-(4-Hydroxyphenyl)-5,7-dihydroxy-6-[2-hydroxy-5-(4-oxo-5,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-2-yl)phenyl]-4H-1-benzopyran-4-one |
![2D Structure of 2-(4-Hydroxyphenyl)-5,7-dihydroxy-6-[2-hydroxy-5-(4-oxo-5,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-2-yl)phenyl]-4H-1-benzopyran-4-one 2D Structure of 2-(4-Hydroxyphenyl)-5,7-dihydroxy-6-[2-hydroxy-5-(4-oxo-5,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-2-yl)phenyl]-4H-1-benzopyran-4-one](https://plantaedb.com/storage/docs/compounds/2023/07/b5c20b30-25fd-11ee-a157-c7be6d524eef.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.82% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.06% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.29% | 98.35% |
CHEMBL3194 | P02766 | Transthyretin | 95.26% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.32% | 96.21% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 93.15% | 85.11% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 92.65% | 97.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.36% | 99.23% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 91.52% | 91.76% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.20% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.03% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 90.80% | 95.78% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.80% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.76% | 95.56% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.18% | 96.12% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.48% | 88.48% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.29% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.10% | 95.89% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.94% | 83.10% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.67% | 91.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.34% | 95.64% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 84.86% | 89.23% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.89% | 91.38% |
CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 82.30% | 95.20% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.94% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.73% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.18% | 85.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.28% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dacrycarpus imbricatus |
Selaginella lepidophylla |
Selaginella nothohybrida |
Selaginella pulvinata |
Selaginella tamariscina |
PubChem | 76315513 |
NPASS | NPC182555 |
ChEMBL | CHEMBL2253314 |
LOTUS | LTS0128343 |
wikiData | Q104073209 |