[8-Acetyloxy-5-hydroxy-13-(hydroxymethyl)-6,16,18-trimethoxy-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate
| Internal ID | bf252466-80ae-4e19-b583-9ab5103d9cca |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
| IUPAC Name | [8-acetyloxy-5-hydroxy-13-(hydroxymethyl)-6,16,18-trimethoxy-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| SMILES (Canonical) | CC(=O)OC12CC(C3(CC(C1C3OC(=O)C4=CC=CC=C4)C56C(CCC7(C5C(C2C6N(C7)C)OC)CO)OC)O)OC |
| SMILES (Isomeric) | CC(=O)OC12CC(C3(CC(C1C3OC(=O)C4=CC=CC=C4)C56C(CCC7(C5C(C2C6N(C7)C)OC)CO)OC)O)OC |
| InChI | InChI=1S/C32H43NO9/c1-17(35)42-31-14-21(39-4)30(37)13-19(22(31)27(30)41-28(36)18-9-7-6-8-10-18)32-20(38-3)11-12-29(16-34)15-33(2)26(32)23(31)24(40-5)25(29)32/h6-10,19-27,34,37H,11-16H2,1-5H3 |
| InChI Key | MMDPDEYRVTTXHD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H43NO9 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.29378195 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of [8-Acetyloxy-5-hydroxy-13-(hydroxymethyl)-6,16,18-trimethoxy-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/b4df9c60-85cf-11ee-85f2-c5a32a4f2395.jpg "2D Structure of [8-Acetyloxy-5-hydroxy-13-(hydroxymethyl)-6,16,18-trimethoxy-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.09% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.48% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.98% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.22% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.29% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.82% | 99.23% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.90% | 94.08% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.77% | 93.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.22% | 90.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.17% | 97.25% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.71% | 81.11% |
| CHEMBL5028 | O14672 | ADAM10 | 86.09% | 97.50% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.21% | 96.47% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.96% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.33% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.29% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.95% | 95.89% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.13% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Delphinium staphisagria |
| PubChem | 14337196 |
| LOTUS | LTS0085294 |
| wikiData | Q105167635 |