(2Z,4E)-5-[(3S,8S)-8-hydroxy-1,5-dimethyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid
Internal ID | 01510934-0953-47dd-8d66-a6f5df39528d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Abscisic acids and derivatives |
IUPAC Name | (2Z,4E)-5-[(3S,8S)-8-hydroxy-1,5-dimethyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
SMILES (Canonical) | CC(=CC(=O)O)C=CC1(C2(CC(CC1(OC2)C)OC3C(C(C(C(O3)CO)O)O)O)C)O |
SMILES (Isomeric) | C/C(=C/C(=O)O)/C=C/[C@@]1(C2(C[C@@H](CC1(OC2)C)OC3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C)O |
InChI | InChI=1S/C21H32O10/c1-11(6-14(23)24)4-5-21(28)19(2)7-12(8-20(21,3)29-10-19)30-18-17(27)16(26)15(25)13(9-22)31-18/h4-6,12-13,15-18,22,25-28H,7-10H2,1-3H3,(H,23,24)/b5-4+,11-6-/t12-,13+,15+,16-,17+,18?,19?,20?,21-/m0/s1 |
InChI Key | UHHVHDDICOEBTQ-XBFXCFGLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H32O10 |
Molecular Weight | 444.50 g/mol |
Exact Mass | 444.19954721 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.85% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.49% | 94.45% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 92.59% | 91.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.23% | 97.09% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 86.21% | 95.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.09% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.94% | 89.00% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 84.04% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.77% | 92.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.93% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.48% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.38% | 91.19% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.32% | 95.50% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.88% | 92.32% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.52% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.22% | 99.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.95% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus phoenicea |
PubChem | 163194341 |
LOTUS | LTS0071204 |
wikiData | Q105272894 |