(2S,3S,4S,5R,6S)-6-[4-[7-[(2S,3S,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4-oxochromen-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid
Internal ID | ddd8d6d0-01c4-4854-8642-91c95bb36cd3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-[7-[(2S,3S,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4-oxochromen-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)OC6C(C(C(C(O6)C(=O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@H]([C@H]([C@@H]([C@@H](O4)C(=O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O |
InChI | InChI=1S/C33H36O22/c34-8-16-18(37)19(38)24(43)32(52-16)55-28-23(42)22(41)27(30(47)48)54-33(28)50-11-5-12(35)17-13(36)7-14(51-15(17)6-11)9-1-3-10(4-2-9)49-31-25(44)20(39)21(40)26(53-31)29(45)46/h1-7,16,18-28,31-35,37-44H,8H2,(H,45,46)(H,47,48)/t16-,18-,19+,20+,21+,22+,23+,24-,25-,26+,27-,28+,31-,32+,33-/m1/s1 |
InChI Key | QHUYAVQUOQPHFT-PVAVAHCOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H36O22 |
Molecular Weight | 784.60 g/mol |
Exact Mass | 784.16982277 g/mol |
Topological Polar Surface Area (TPSA) | 359.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of (2S,3S,4S,5R,6S)-6-[4-[7-[(2S,3S,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4-oxochromen-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid 2D Structure of (2S,3S,4S,5R,6S)-6-[4-[7-[(2S,3S,4S,5S,6R)-6-carboxy-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-4-oxochromen-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/b40d13b0-8534-11ee-99f3-fdcda1fdb9ef.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.69% | 91.49% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 95.97% | 83.57% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.94% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.41% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 94.21% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.85% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.48% | 94.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 90.68% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.60% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.30% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.05% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.42% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.55% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.19% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.08% | 94.45% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.18% | 91.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.14% | 95.78% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.75% | 89.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.68% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.79% | 97.36% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.57% | 94.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.32% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Medicago sativa |
PubChem | 162849054 |
LOTUS | LTS0081030 |
wikiData | Q105221156 |