(7R,20R)-11,24-dihydroxy-7,20-di(propan-2-yl)-8,16,21,30-tetraoxaoctacyclo[15.11.1.14,28.02,15.03,12.05,10.018,23.025,29]triaconta-1,3,5(10),11,14,17(29),18(23),24,27-nonaene-9,13,22,26-tetrone
| Internal ID | cc8e8424-df12-478b-a89b-c706f4fbaa11 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes > Benzoxanthenes |
| IUPAC Name | (7R,20R)-11,24-dihydroxy-7,20-di(propan-2-yl)-8,16,21,30-tetraoxaoctacyclo[15.11.1.14,28.02,15.03,12.05,10.018,23.025,29]triaconta-1,3,5(10),11,14,17(29),18(23),24,27-nonaene-9,13,22,26-tetrone |
| SMILES (Canonical) | CC(C)C1CC2=C(C(=C3C(=O)C=C4C5=C6C(=CC(=O)C7=C(C8=C(CC(OC8=O)C(C)C)C(=C67)O4)O)OC2=C53)O)C(=O)O1 |
| SMILES (Isomeric) | CC(C)[C@H]1CC2=C(C(=C3C(=O)C=C4C5=C6C(=CC(=O)C7=C(C8=C(C[C@@H](OC8=O)C(C)C)C(=C67)O4)O)OC2=C53)O)C(=O)O1 |
| InChI | InChI=1S/C32H24O10/c1-9(2)15-5-11-19(31(37)41-15)27(35)21-13(33)8-18-23-24-17(39-29(11)25(21)23)7-14(34)22-26(24)30(40-18)12-6-16(10(3)4)42-32(38)20(12)28(22)36/h7-10,15-16,35-36H,5-6H2,1-4H3/t15-,16-/m1/s1 |
| InChI Key | FHFVNJZHZNUJEP-HZPDHXFCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H24O10 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.13694696 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.12% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.68% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.19% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.93% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.20% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.66% | 85.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.82% | 95.89% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.75% | 85.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.53% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.11% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.08% | 90.71% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.96% | 89.34% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.66% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.61% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.25% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.26% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163103968 |
| LOTUS | LTS0023524 |
| wikiData | Q104995239 |