[(3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-3,4a,7,10a-tetramethyl-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
Internal ID | b99e0bb6-b230-4d41-bb8c-879bd341be0c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-3,4a,7,10a-tetramethyl-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1(CCC2C3(CCC(C(C3CCC2(O1)C)(C)COC4C(C(C(C(O4)CO)O)O)O)OC(=O)C=CC5=CC(=C(C(=C5)OC)O)OC)C)C=C |
SMILES (Isomeric) | C[C@@]1(CC[C@@H]2[C@]3(CC[C@H]([C@@]([C@@H]3CC[C@]2(O1)C)(C)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC(=O)/C=C/C5=CC(=C(C(=C5)OC)O)OC)C)C=C |
InChI | InChI=1S/C37H54O12/c1-8-34(2)14-11-26-35(3)15-13-27(48-28(39)10-9-21-17-22(44-6)29(40)23(18-21)45-7)36(4,25(35)12-16-37(26,5)49-34)20-46-33-32(43)31(42)30(41)24(19-38)47-33/h8-10,17-18,24-27,30-33,38,40-43H,1,11-16,19-20H2,2-7H3/b10-9+/t24-,25-,26-,27-,30-,31+,32-,33-,34+,35+,36+,37-/m1/s1 |
InChI Key | UTFOKRYLFYXSFK-SRZDFJDLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H54O12 |
Molecular Weight | 690.80 g/mol |
Exact Mass | 690.36152715 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 3.80 |
There are no found synonyms. |
![2D Structure of [(3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-3,4a,7,10a-tetramethyl-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate 2D Structure of [(3R,4aR,6aR,7R,8R,10aS,10bR)-3-ethenyl-3,4a,7,10a-tetramethyl-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/b2d2c000-8691-11ee-96c4-8d47d8f8ea97.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.98% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.95% | 89.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.41% | 83.82% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.68% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.84% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.33% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.31% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.13% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.97% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.00% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.34% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.32% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.99% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.13% | 92.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.01% | 97.36% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.57% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.66% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.40% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eleutherococcus brachypus |
PubChem | 163189991 |
LOTUS | LTS0072603 |
wikiData | Q105278739 |