[(3R,3aS,9S,9aS,9bS)-9-hydroxy-3,9-dimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-6-yl]methyl acetate
| Internal ID | 0d5eea44-62a2-4fca-be55-bca4fde33b39 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | [(3R,3aS,9S,9aS,9bS)-9-hydroxy-3,9-dimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-6-yl]methyl acetate |
| SMILES (Canonical) | CC1C2CCC(=C3C=CC(C3C2OC1=O)(C)O)COC(=O)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H]2CCC(=C3C=C[C@]([C@@H]3[C@H]2OC1=O)(C)O)COC(=O)C |
| InChI | InChI=1S/C17H22O5/c1-9-12-5-4-11(8-21-10(2)18)13-6-7-17(3,20)14(13)15(12)22-16(9)19/h6-7,9,12,14-15,20H,4-5,8H2,1-3H3/t9-,12+,14+,15+,17+/m1/s1 |
| InChI Key | LQDDEDJLTRMOTI-IKYOHUOBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of [(3R,3aS,9S,9aS,9bS)-9-hydroxy-3,9-dimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-6-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/b2694f50-83e3-11ee-9800-0fa6f0a27481.jpg "2D Structure of [(3R,3aS,9S,9aS,9bS)-9-hydroxy-3,9-dimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-6-yl]methyl acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.00% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.80% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.94% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.07% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.38% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.87% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.54% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.33% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.73% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.04% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.00% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.47% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.81% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.13% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.47% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ursinia nudicaulis |
| PubChem | 101625603 |
| LOTUS | LTS0043298 |
| wikiData | Q105155481 |