10,23-Dihydroxy-6,6,20,20-tetramethyl-11-(3-methylbut-2-enyl)-5,13,15,21-tetraoxahexacyclo[12.11.0.03,12.04,9.016,25.017,22]pentacosa-1(14),3,9,11,16,18,22,24-octaen-2-one
| Internal ID | 8e74c29f-10b0-472a-9c4d-783542fc52dd |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
| IUPAC Name | 10,23-dihydroxy-6,6,20,20-tetramethyl-11-(3-methylbut-2-enyl)-5,13,15,21-tetraoxahexacyclo[12.11.0.03,12.04,9.016,25.017,22]pentacosa-1(14),3,9,11,16,18,22,24-octaen-2-one |
| SMILES (Canonical) | CC(=CCC1=C2C(=C3C(=C1O)CCC(O3)(C)C)C(=O)C4=C(O2)OC5=C6C=CC(OC6=C(C=C45)O)(C)C)C |
| SMILES (Isomeric) | CC(=CCC1=C2C(=C3C(=C1O)CCC(O3)(C)C)C(=O)C4=C(O2)OC5=C6C=CC(OC6=C(C=C45)O)(C)C)C |
| InChI | InChI=1S/C30H30O7/c1-14(2)7-8-15-22(32)16-9-11-30(5,6)37-27(16)21-23(33)20-18-13-19(31)25-17(10-12-29(3,4)36-25)24(18)34-28(20)35-26(15)21/h7,10,12-13,31-32H,8-9,11H2,1-6H3 |
| InChI Key | YVHWZHNBUWUNCZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.19915329 g/mol |
| Topological Polar Surface Area (TPSA) | 98.40 Ų |
| XlogP | 6.80 |
| There are no found synonyms. |
![2D Structure of 10,23-Dihydroxy-6,6,20,20-tetramethyl-11-(3-methylbut-2-enyl)-5,13,15,21-tetraoxahexacyclo[12.11.0.03,12.04,9.016,25.017,22]pentacosa-1(14),3,9,11,16,18,22,24-octaen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/b238ca00-8725-11ee-b637-e13bef1f8298.jpg "2D Structure of 10,23-Dihydroxy-6,6,20,20-tetramethyl-11-(3-methylbut-2-enyl)-5,13,15,21-tetraoxahexacyclo[12.11.0.03,12.04,9.016,25.017,22]pentacosa-1(14),3,9,11,16,18,22,24-octaen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.11% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.46% | 91.49% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.99% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.59% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.33% | 89.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.41% | 85.30% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.11% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.83% | 95.56% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.33% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.07% | 94.73% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.82% | 91.38% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.66% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.62% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.52% | 95.89% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 85.20% | 80.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.79% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.04% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euchresta formosana |
| PubChem | 10345944 |
| LOTUS | LTS0222900 |
| wikiData | Q105365384 |