12,14,14,19-tetramethyl-16-[3-[2-(methylamino)ethyl]-1H-indol-2-yl]-8,19-diazapentacyclo[7.7.3.01,9.02,7.010,15]nonadeca-2,4,6-trien-12-ol
Internal ID | 93acf6c9-c523-4164-8c09-8e8b3dde23ca |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyrroloindoles |
IUPAC Name | 12,14,14,19-tetramethyl-16-[3-[2-(methylamino)ethyl]-1H-indol-2-yl]-8,19-diazapentacyclo[7.7.3.01,9.02,7.010,15]nonadeca-2,4,6-trien-12-ol |
SMILES (Canonical) | CC1(CC(CC2C1C(C34C2(NC5=CC=CC=C53)N(CC4)C)C6=C(C7=CC=CC=C7N6)CCNC)(C)O)C |
SMILES (Isomeric) | CC1(CC(CC2C1C(C34C2(NC5=CC=CC=C53)N(CC4)C)C6=C(C7=CC=CC=C7N6)CCNC)(C)O)C |
InChI | InChI=1S/C32H42N4O/c1-29(2)19-30(3,37)18-23-26(29)27(28-21(14-16-33-4)20-10-6-8-12-24(20)34-28)31-15-17-36(5)32(23,31)35-25-13-9-7-11-22(25)31/h6-13,23,26-27,33-35,37H,14-19H2,1-5H3 |
InChI Key | STAWTYGVTDPQIW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42N4O |
Molecular Weight | 498.70 g/mol |
Exact Mass | 498.33586198 g/mol |
Topological Polar Surface Area (TPSA) | 63.30 Ų |
XlogP | 5.20 |
There are no found synonyms. |
![2D Structure of 12,14,14,19-tetramethyl-16-[3-[2-(methylamino)ethyl]-1H-indol-2-yl]-8,19-diazapentacyclo[7.7.3.01,9.02,7.010,15]nonadeca-2,4,6-trien-12-ol 2D Structure of 12,14,14,19-tetramethyl-16-[3-[2-(methylamino)ethyl]-1H-indol-2-yl]-8,19-diazapentacyclo[7.7.3.01,9.02,7.010,15]nonadeca-2,4,6-trien-12-ol](https://plantaedb.com/storage/docs/compounds/2023/11/b213b180-869f-11ee-acae-23a893d8c4fe.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.26% | 96.09% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 97.69% | 95.00% |
CHEMBL222 | P23975 | Norepinephrine transporter | 97.29% | 96.06% |
CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.73% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.77% | 91.11% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 94.25% | 98.59% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.82% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.66% | 94.75% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 90.95% | 97.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.75% | 95.17% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.19% | 90.17% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.43% | 91.79% |
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 88.10% | 97.15% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 88.10% | 96.39% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.29% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.17% | 93.99% |
CHEMBL5028 | O14672 | ADAM10 | 87.08% | 97.50% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.97% | 82.69% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.81% | 94.62% |
CHEMBL233 | P35372 | Mu opioid receptor | 86.39% | 97.93% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 86.37% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.27% | 90.00% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.63% | 88.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.59% | 95.83% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.91% | 93.03% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.49% | 96.25% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 83.09% | 85.83% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.65% | 92.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.54% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.14% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.97% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.62% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Flindersia fournieri |
PubChem | 163004006 |
LOTUS | LTS0133305 |
wikiData | Q105260099 |