[(1R,2R,3S,4S,5R)-3,4,5-trihydroxy-2-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate
| Internal ID | 586cc722-f249-4242-a833-a0ff9950aa8f |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives > Galloyl esters |
| IUPAC Name | [(1R,2R,3S,4S,5R)-3,4,5-trihydroxy-2-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | C1C(C(C(C(C1OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
| SMILES (Isomeric) | C1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
| InChI | InChI=1S/C20H20O13/c21-8-1-6(2-9(22)14(8)26)19(30)32-13-5-12(25)16(28)17(29)18(13)33-20(31)7-3-10(23)15(27)11(24)4-7/h1-4,12-13,16-18,21-29H,5H2/t12-,13-,16+,17+,18+/m1/s1 |
| InChI Key | SUBHIYSPOQCZTL-XZFSWKSHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O13 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.09039069 g/mol |
| Topological Polar Surface Area (TPSA) | 235.00 Ų |
| XlogP | -0.40 |
| There are no found synonyms. |
![2D Structure of [(1R,2R,3S,4S,5R)-3,4,5-trihydroxy-2-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/b18c5570-8325-11ee-a6eb-8b7b8499ed0d.jpg "2D Structure of [(1R,2R,3S,4S,5R)-3,4,5-trihydroxy-2-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.32% | 91.49% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 91.79% | 97.53% |
| CHEMBL3194 | P02766 | Transthyretin | 91.19% | 90.71% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.76% | 97.21% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.07% | 83.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.20% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.94% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.98% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.79% | 90.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.65% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.35% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.33% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.28% | 92.94% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.97% | 95.64% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.93% | 98.95% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.92% | 91.07% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.19% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Quercus acuta |
| Quercus salicina |
| PubChem | 162973826 |
| LOTUS | LTS0157468 |
| wikiData | Q105260781 |