2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 562333fc-9239-47e5-9eb9-2c31dcf4541e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=C(C3=O)C(=CC(=C4)O)OC)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=C(C3=O)C(=CC(=C4)O)OC)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-14(39-2)6-11(29)7-15(17)42-25(26)10-3-4-12(30)13(31)5-10/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9-,16+,18-,19-,21-,22-,23+,24+,27+,28-/m0/s1 |
InChI Key | ZQGOPIYRGSTAIY-JHRJPVSPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O16 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.12% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.44% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.99% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.97% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.86% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.74% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.62% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.59% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.34% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.96% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.58% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 85.44% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.29% | 97.36% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.28% | 80.78% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.82% | 94.03% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.31% | 96.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.99% | 95.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.97% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.78% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carya illinoinensis |
PubChem | 162956905 |
LOTUS | LTS0128638 |
wikiData | Q105381457 |