(2R)-1-(4-hydroxy-3-methoxyphenyl)-2-[4-[(E)-3-hydroxyprop-1-enyl]-2-methoxyphenyl]propane-1,2,3-triol
| Internal ID | be42299e-aaf5-4b2c-8c92-5c5c972c34d8 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | (2R)-1-(4-hydroxy-3-methoxyphenyl)-2-[4-[(E)-3-hydroxyprop-1-enyl]-2-methoxyphenyl]propane-1,2,3-triol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C=CCO)C(CO)(C(C2=CC(=C(C=C2)O)OC)O)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/CO)[C@@](CO)(C(C2=CC(=C(C=C2)O)OC)O)O |
| InChI | InChI=1S/C20H24O7/c1-26-17-10-13(4-3-9-21)5-7-15(17)20(25,12-22)19(24)14-6-8-16(23)18(11-14)27-2/h3-8,10-11,19,21-25H,9,12H2,1-2H3/b4-3+/t19?,20-/m0/s1 |
| InChI Key | QPTMXJUPAZKGLJ-AARAPKBOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 120.00 Ų |
| XlogP | 0.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.19% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.20% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.37% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.63% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.56% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.32% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.25% | 89.62% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.22% | 92.68% |
| CHEMBL3194 | P02766 | Transthyretin | 87.44% | 90.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.88% | 85.14% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.93% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.73% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.55% | 94.73% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.92% | 91.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.97% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.19% | 95.89% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.16% | 96.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anastatica hierochuntica |
| PubChem | 162817362 |
| LOTUS | LTS0078466 |
| wikiData | Q105225595 |