[(1S,2S,5S,6S,7R,8S,9R,12R)-5,12-diacetyloxy-6-(acetyloxymethyl)-2,8-dihydroxy-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (E)-3-phenylprop-2-enoate
| Internal ID | cb3e764b-ddcb-4125-86b6-8e96bd373489 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Agarofurans |
| IUPAC Name | [(1S,2S,5S,6S,7R,8S,9R,12R)-5,12-diacetyloxy-6-(acetyloxymethyl)-2,8-dihydroxy-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (E)-3-phenylprop-2-enoate |
| SMILES (Canonical) | CC(=O)OCC12C(CCC(C13C(C(C(C2OC(=O)C=CC4=CC=CC=C4)O)C(O3)(C)C)OC(=O)C)(C)O)OC(=O)C |
| SMILES (Isomeric) | CC(=O)OC[C@@]12[C@H](CC[C@]([C@@]13[C@@H]([C@@H]([C@@H]([C@@H]2OC(=O)/C=C/C4=CC=CC=C4)O)C(O3)(C)C)OC(=O)C)(C)O)OC(=O)C |
| InChI | InChI=1S/C30H38O11/c1-17(31)37-16-29-21(38-18(2)32)14-15-28(6,36)30(29)25(39-19(3)33)23(27(4,5)41-30)24(35)26(29)40-22(34)13-12-20-10-8-7-9-11-20/h7-13,21,23-26,35-36H,14-16H2,1-6H3/b13-12+/t21-,23+,24-,25+,26-,28-,29-,30-/m0/s1 |
| InChI Key | PVKRLWLUFLRCHV-PVXREPHISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H38O11 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.24141202 g/mol |
| Topological Polar Surface Area (TPSA) | 155.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.73% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.95% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.04% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.98% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.87% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.41% | 94.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.84% | 85.14% |
| CHEMBL5028 | O14672 | ADAM10 | 90.18% | 97.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.82% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.46% | 83.82% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.45% | 93.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.88% | 95.89% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.57% | 94.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.53% | 97.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.78% | 95.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.75% | 92.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.87% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Denhamia celastroides |
| PubChem | 118726317 |
| LOTUS | LTS0208248 |
| wikiData | Q105215485 |