[17-acetyl-3-[5-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14-dihydroxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate
Internal ID | 2c47e0d3-b028-4061-bc31-8862dda4457a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [17-acetyl-3-[5-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14-dihydroxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)C(=O)C)C)OC(=O)C=CC9=CC=CC=C9)C)C)C)C)O)OC)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)C(=O)C)C)OC(=O)C=CC9=CC=CC=C9)C)C)C)C)O)OC)O |
InChI | InChI=1S/C58H86O19/c1-30(59)38-21-24-58(64)56(38,7)43(74-44(60)18-17-35-15-13-12-14-16-35)29-42-55(6)22-20-37(25-36(55)19-23-57(42,58)63)73-45-26-39(65-8)50(32(3)69-45)75-46-27-40(66-9)51(33(4)70-46)76-47-28-41(67-10)52(34(5)71-47)77-54-49(62)53(68-11)48(61)31(2)72-54/h12-19,31-34,37-43,45-54,61-64H,20-29H2,1-11H3 |
InChI Key | HJNZDAJLZVYELM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H86O19 |
Molecular Weight | 1087.30 g/mol |
Exact Mass | 1086.57633051 g/mol |
Topological Polar Surface Area (TPSA) | 235.00 Ų |
XlogP | 3.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.70% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.88% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.09% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.96% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.21% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.55% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 91.94% | 97.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.67% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.00% | 94.08% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.17% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.00% | 100.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.89% | 83.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.27% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.77% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.36% | 99.23% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.56% | 97.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.34% | 91.07% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.32% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.16% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.09% | 100.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.21% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Araujia sericifera |
Asclepias tuberosa |
PubChem | 73120603 |
LOTUS | LTS0137716 |
wikiData | Q105029356 |