[(1S,2R,13R,14R,15R,16R,17S,28R)-8,23,28-trihydroxy-6,21-dimethyl-3,10,18,25-tetraoxo-14-octacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4(9),5,7,11,19(24),20,22,26-octaenyl] acetate
| Internal ID | 78359506-0f07-463d-a3eb-e349c994b50c |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | [(1S,2R,13R,14R,15R,16R,17S,28R)-8,23,28-trihydroxy-6,21-dimethyl-3,10,18,25-tetraoxo-14-octacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4(9),5,7,11,19(24),20,22,26-octaenyl] acetate |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=CC4C(C5C3(C2=O)C6C=C7C4(C5C6O)C(=O)C8=C(C7=O)C(=CC(=C8)C)O)OC(=O)C |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)C3=C[C@H]4[C@H]([C@H]5[C@]3(C2=O)[C@@H]6C=C7[C@@]4([C@@H]5[C@@H]6O)C(=O)C8=C(C7=O)C(=CC(=C8)C)O)OC(=O)C |
| InChI | InChI=1S/C32H24O9/c1-10-4-13-21(19(34)6-10)26(37)16-9-18-28(41-12(3)33)24-23-27(38)17(31(16,24)29(13)39)8-15-25(36)22-14(30(40)32(15,18)23)5-11(2)7-20(22)35/h4-9,17-18,23-24,27-28,34-35,38H,1-3H3/t17-,18+,23+,24+,27-,28-,31-,32-/m1/s1 |
| InChI Key | RMNYMQYTXWYIAM-GJORHNLFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H24O9 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.14203234 g/mol |
| Topological Polar Surface Area (TPSA) | 155.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.11% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.92% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.05% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.96% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.70% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.87% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.62% | 99.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.91% | 97.21% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.87% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.41% | 90.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.90% | 96.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.36% | 91.19% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.71% | 94.62% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.48% | 96.95% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 82.89% | 97.53% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.73% | 94.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.51% | 92.94% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.08% | 86.92% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.62% | 96.90% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.10% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163190649 |
| LOTUS | LTS0197957 |
| wikiData | Q105240926 |