(3,5-Dihydroxy-6,10,13-trimethyl-2-methylidene-4-oxo-16-propan-2-yl-15-tetracyclo[9.7.0.03,7.013,17]octadeca-5,9-dienyl) 3-hydroxy-3,5-dimethylheptanoate
| Internal ID | 74aa792b-6795-4d58-9cb1-71b1a373af7b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids > Scalarane sesterterpenoids |
| IUPAC Name | (3,5-dihydroxy-6,10,13-trimethyl-2-methylidene-4-oxo-16-propan-2-yl-15-tetracyclo[9.7.0.03,7.013,17]octadeca-5,9-dienyl) 3-hydroxy-3,5-dimethylheptanoate |
| SMILES (Canonical) | CCC(C)CC(C)(CC(=O)OC1CC2(CC3C(CC2C1C(C)C)C(=C)C4(C(CC=C3C)C(=C(C4=O)O)C)O)C)O |
| SMILES (Isomeric) | CCC(C)CC(C)(CC(=O)OC1CC2(CC3C(CC2C1C(C)C)C(=C)C4(C(CC=C3C)C(=C(C4=O)O)C)O)C)O |
| InChI | InChI=1S/C34H52O6/c1-10-19(4)14-33(9,38)17-28(35)40-27-16-32(8)15-24-20(5)11-12-25-21(6)30(36)31(37)34(25,39)22(7)23(24)13-26(32)29(27)18(2)3/h11,18-19,23-27,29,36,38-39H,7,10,12-17H2,1-6,8-9H3 |
| InChI Key | XCBZBPKHZFIJGF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H52O6 |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.37638937 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.20% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.73% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 97.21% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.80% | 98.95% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 95.65% | 92.68% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.26% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.01% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.39% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.42% | 96.77% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.26% | 93.56% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 92.23% | 85.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.95% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.94% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.92% | 89.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.30% | 97.21% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.40% | 90.93% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.52% | 99.23% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.50% | 96.21% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.32% | 96.47% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.58% | 96.90% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.36% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.09% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.99% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.54% | 94.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.14% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.06% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162849104 |
| LOTUS | LTS0076322 |
| wikiData | Q104200833 |