3-[(2R,3R,4R,5S,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one
Internal ID | 5ff4368d-b134-478f-9fd4-a4204fa43772 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2R,3R,4R,5S,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)OC5C(C(C(CO5)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]([C@H]([C@H]([C@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)O)O |
InChI | InChI=1S/C26H28O15/c1-8-17(32)20(35)24(41-25-21(36)18(33)14(31)7-37-25)26(38-8)40-23-19(34)16-13(30)5-10(27)6-15(16)39-22(23)9-2-3-11(28)12(29)4-9/h2-6,8,14,17-18,20-21,24-33,35-36H,7H2,1H3/t8-,14-,17+,18-,20+,21+,24+,25-,26+/m0/s1 |
InChI Key | WRLBRIWXGBKVHQ-WMEPHKERSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O15 |
Molecular Weight | 580.50 g/mol |
Exact Mass | 580.14282018 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of 3-[(2R,3R,4R,5S,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one 2D Structure of 3-[(2R,3R,4R,5S,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/b0cecac0-85a9-11ee-80d3-79d1d66afcca.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.78% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.43% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.05% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.43% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.76% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.11% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.01% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.97% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.71% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.34% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.50% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.00% | 97.36% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.73% | 99.23% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.64% | 95.78% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.51% | 95.53% |
CHEMBL3194 | P02766 | Transthyretin | 81.98% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.05% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.97% | 97.09% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.72% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kalanchoe pinnata |
PubChem | 162989289 |
LOTUS | LTS0084929 |
wikiData | Q105311367 |