(6,9-Dimethylspiro[4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-diene-10,2'-oxirane]-8-yl) 2-methylpropanoate
Internal ID | 7e4070ce-80d8-40ca-a3b5-b2a527fc50b7 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (6,9-dimethylspiro[4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-diene-10,2'-oxirane]-8-yl) 2-methylpropanoate |
SMILES (Canonical) | CC1=COC2=C1C(C3(C4(CCC5C3(C2)O5)CO4)C)OC(=O)C(C)C |
SMILES (Isomeric) | CC1=COC2=C1C(C3(C4(CCC5C3(C2)O5)CO4)C)OC(=O)C(C)C |
InChI | InChI=1S/C19H24O5/c1-10(2)16(20)23-15-14-11(3)8-21-12(14)7-19-13(24-19)5-6-18(9-22-18)17(15,19)4/h8,10,13,15H,5-7,9H2,1-4H3 |
InChI Key | RFSNMFBYOUHKNE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O5 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 64.50 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of (6,9-Dimethylspiro[4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-diene-10,2'-oxirane]-8-yl) 2-methylpropanoate 2D Structure of (6,9-Dimethylspiro[4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-diene-10,2'-oxirane]-8-yl) 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/b0a99ef0-8616-11ee-bd1b-316e98de7cc3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.41% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.34% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.66% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.09% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.98% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.82% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.51% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.53% | 96.47% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.97% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.54% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 85.33% | 98.95% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.04% | 98.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.82% | 96.21% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.33% | 95.71% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 82.30% | 95.34% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 80.89% | 92.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.76% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 80.66% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euryops jacksonii |
PubChem | 14890351 |
LOTUS | LTS0110142 |
wikiData | Q105235588 |