[4,5-Dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] 10-[4-[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-11-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
| Internal ID | 102da490-620a-4999-81cc-5bde73a5b8d7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | [4,5-dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] 10-[4-[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-11-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC(=O)C23CCC(CC2C4=CCC5C(C4(CC3)C)(CCC6C5(CC(C(C6(C)C)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)O)O)C)C)(C)C)OC1C(C(C(C(O1)CO)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC(=O)C23CCC(CC2C4=CCC5C(C4(CC3)C)(CCC6C5(CC(C(C6(C)C)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)O)O)C)C)(C)C)OC1C(C(C(C(O1)CO)O)O)O)O)O |
| InChI | InChI=1S/C58H94O26/c1-23-33(64)39(70)45(82-48-41(72)38(69)36(67)29(19-59)78-48)51(77-23)84-52(74)58-15-13-53(2,3)17-25(58)24-9-10-32-55(6)18-26(61)46(54(4,5)31(55)11-12-57(32,8)56(24,7)14-16-58)83-49-42(73)43(37(68)30(20-60)79-49)80-50-44(35(66)28(63)22-76-50)81-47-40(71)34(65)27(62)21-75-47/h9,23,25-51,59-73H,10-22H2,1-8H3 |
| InChI Key | UBNOWMBWPVLAHC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C58H94O26 |
| Molecular Weight | 1207.30 g/mol |
| Exact Mass | 1206.60333310 g/mol |
| Topological Polar Surface Area (TPSA) | 413.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.92% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.66% | 95.17% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.35% | 97.36% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.49% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.21% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.28% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.17% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.84% | 86.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.28% | 96.77% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.33% | 91.24% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.96% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.94% | 95.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.63% | 95.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.24% | 91.07% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.75% | 96.21% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.86% | 83.57% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.70% | 96.61% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.33% | 94.33% |
| CHEMBL5028 | O14672 | ADAM10 | 81.65% | 97.50% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.27% | 86.92% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.71% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.70% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.43% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cylicodiscus gabunensis |
| PubChem | 162905997 |
| LOTUS | LTS0082633 |
| wikiData | Q105269513 |