(4,10,19-Triacetyloxy-9,18-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylbutanoate
| Internal ID | 32b066c8-d0b9-468d-8d56-5bf556ceb366 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids |
| IUPAC Name | (4,10,19-triacetyloxy-9,18-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylbutanoate |
| SMILES (Canonical) | CCC(C)C(=O)OC1CC23C4C5CC67C2(C(C(C(C6(C3N5CC4(C1OC(=O)C)C)O)OC(=O)C)C(=C)C7)OC(=O)C)O |
| SMILES (Isomeric) | CCC(C)C(=O)OC1CC23C4C5CC67C2(C(C(C(C6(C3N5CC4(C1OC(=O)C)C)O)OC(=O)C)C(=C)C7)OC(=O)C)O |
| InChI | InChI=1S/C31H41NO10/c1-8-13(2)25(36)42-19-11-29-21-18-10-28-9-14(3)20(24(31(28,29)38)41-17(6)35)23(40-16(5)34)30(28,37)26(29)32(18)12-27(21,7)22(19)39-15(4)33/h13,18-24,26,37-38H,3,8-12H2,1-2,4-7H3 |
| InChI Key | MYJFNJPQVVCTMB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H41NO10 |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.27304650 g/mol |
| Topological Polar Surface Area (TPSA) | 149.00 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.24% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.18% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.14% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.74% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.53% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.55% | 91.19% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.63% | 89.50% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.72% | 82.50% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.99% | 97.28% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.04% | 93.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.92% | 96.47% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.45% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.65% | 97.09% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.23% | 95.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73819179 |
| LOTUS | LTS0131796 |
| wikiData | Q105174950 |