Azuleno(4,5-b)furan-2(3H)-one, decahydro-5,8-dihydroxy-3,9-dimethyl-6-methylene-
| Internal ID | 14defe90-cb8d-4acd-8b21-a9987fa59183 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | 5,8-dihydroxy-3,9-dimethyl-6-methylidene-3,3a,4,5,6a,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-2-one |
| SMILES (Canonical) | CC1C(CC2C1C3C(CC(C2=C)O)C(C(=O)O3)C)O |
| SMILES (Isomeric) | CC1C(CC2C1C3C(CC(C2=C)O)C(C(=O)O3)C)O |
| InChI | InChI=1S/C15H22O4/c1-6-9-4-12(17)8(3)13(9)14-10(5-11(6)16)7(2)15(18)19-14/h7-14,16-17H,1,4-5H2,2-3H3 |
| InChI Key | FZHVZHPJLXWJIZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.10 |
| Azuleno(4,5-b)furan-2(3H)-one, decahydro-5,8-dihydroxy-3,9-dimethyl-6-methylene- |
| DTXSID201008007 |
| 5,8-Dihydroxy-3,9-dimethyl-6-methylidenedecahydroazuleno[4,5-b]furan-2(3H)-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.12% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.62% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.91% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.76% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.71% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.12% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.65% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.68% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.03% | 98.95% |
| CHEMBL3974 | P25116 | Proteinase-activated receptor 1 | 83.26% | 97.78% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.76% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.54% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arctotis stoechadifolia |
| Crepis foetida |
| Crepis foetida subsp. rhoeadifolia |
| Lactuca sativa |
| Lepidaploa sagraeana |
| PubChem | 159226 |
| LOTUS | LTS0186794 |
| wikiData | Q83004322 |