Azadiradionolide
Internal ID | de26052a-3273-4001-a45d-ce77083c9ca8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(5R,7R,8R,9R,10R,13R,17R)-4,4,8,10,13-pentamethyl-3,16-dioxo-17-(5-oxo-2H-furan-4-yl)-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2C(C(=O)C=CC2(C3C1(C4=CC(=O)C(C4(CC3)C)C5=CCOC5=O)C)C)(C)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1(C4=CC(=O)[C@H]([C@]4(CC3)C)C5=CCOC5=O)C)C |
InChI | InChI=1S/C28H34O6/c1-15(29)34-22-14-19-25(2,3)21(31)8-11-26(19,4)18-7-10-27(5)20(28(18,22)6)13-17(30)23(27)16-9-12-33-24(16)32/h8-9,11,13,18-19,22-23H,7,10,12,14H2,1-6H3/t18-,19+,22-,23-,26-,27+,28-/m1/s1 |
InChI Key | ANQXYDNAHFDKKH-AFEVRESMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C28H34O6 |
Molecular Weight | 466.60 g/mol |
Exact Mass | 466.23553880 g/mol |
Topological Polar Surface Area (TPSA) | 86.70 Ų |
XlogP | 4.10 |
CHEBI:67290 |
Q27135749 |
(5alpha,7alpha,17alpha)-4,4,8-trimethyl-3,16-dioxo-17-(2-oxo-2,5-dihydrofuran-3-yl)androsta-1,14-dien-7-yl acetate |
24,25,26,27-tetranorapoeupha-7alpha-acetoxy-21,23-epoxy-1,14,20(22)-trien-3,16,21-trione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.42% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.95% | 85.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.06% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.89% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.78% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.59% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.92% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.85% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.55% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.54% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.03% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 86.91% | 98.95% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.27% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 86.03% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.76% | 97.14% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.55% | 94.80% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.58% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.50% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.51% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Solanum lycopersicum |
PubChem | 70697889 |
LOTUS | LTS0195857 |
wikiData | Q27135749 |