axinisothiocyanate M
| Internal ID | 02820387-ee6e-4685-bdc3-9f778c6ec15a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| IUPAC Name | (2S,4aR,8R,8aR)-8-isothiocyanato-4a,8-dimethyl-2-prop-1-en-2-yl-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol |
| SMILES (Canonical) | CC(=C)C1(CCC2(CCCC(C2C1)(C)N=C=S)C)O |
| SMILES (Isomeric) | CC(=C)[C@@]1(CC[C@]2(CCC[C@@]([C@@H]2C1)(C)N=C=S)C)O |
| InChI | InChI=1S/C16H25NOS/c1-12(2)16(18)9-8-14(3)6-5-7-15(4,17-11-19)13(14)10-16/h13,18H,1,5-10H2,2-4H3/t13-,14-,15-,16+/m1/s1 |
| InChI Key | KKOPPOVHLGSDFF-FPCVCCKLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.16568559 g/mol |
| Topological Polar Surface Area (TPSA) | 64.70 Ų |
| XlogP | 5.00 |
| RefChem:115847 |
| (2S,4aR,8R,8aR)-8-isothiocyanato-4a,8-dimethyl-2-prop-1-en-2-yl-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol |
| 1114491-51-8 |
| CHEMBL460147 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.22% | 97.25% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.65% | 91.49% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.64% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.38% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.57% | 92.94% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.32% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.69% | 96.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.53% | 95.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.99% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.43% | 97.93% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.21% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.36% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25179335 |
| LOTUS | LTS0123552 |
| wikiData | Q103813370 |