Avilamycin
| Internal ID | 29925a6c-981b-4e2d-9ed5-77ed6750bf57 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [(2R,3S,4R,6S)-6-[(2'R,3'S,3aR,4R,4'R,6S,7aR)-6-[(2S,3R,4R,5S,6R)-2-[(2R,3S,4S,5S,6S)-6-[(2R,3aS,3'aR,6'R,7R,7'S,7aR,7'aR)-7'-acetyl-7'-hydroxy-6'-methyl-7-(2-methylpropanoyloxy)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,4'-6,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-6-yl]oxy-4-hydroxy-5-methoxy-2-(methoxymethyl)oxan-3-yl]oxy-3-hydroxy-5-methoxy-6-methyloxan-4-yl]oxy-4'-hydroxy-2',4,7a-trimethylspiro[3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,6'-oxane]-3'-yl]oxy-4-hydroxy-2-methyloxan-3-yl] 3,5-dichloro-4-hydroxy-2-methoxy-6-methylbenzoate |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC3(CC2O)OC4C(OC(CC4(O3)C)OC5C(C(OC(C5OC)C)OC6C(OC(C(C6O)OC)OC7C(C8C(CO7)OC9(O8)C1C(C(C(O9)C)(C(=O)C)O)OCO1)OC(=O)C(C)C)COC)O)C)C)O)OC(=O)C1=C(C(=C(C(=C1OC)Cl)O)Cl)C |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](OC3(C[C@H]2O)O[C@@H]4[C@H](O[C@H](C[C@]4(O3)C)O[C@@H]5[C@H]([C@@H](O[C@@H]([C@@H]5OC)C)O[C@@H]6[C@H](O[C@H]([C@H]([C@H]6O)OC)OC7[C@@H]([C@H]8[C@H](CO7)O[C@@]9(O8)[C@H]1[C@H]([C@@]([C@H](O9)C)(C(=O)C)O)OCO1)OC(=O)C(C)C)COC)O)C)C)O)OC(=O)C1=C(C(=C(C(=C1OC)Cl)O)Cl)C |
| InChI | InChI=1S/C61H88Cl2O32/c1-21(2)53(70)87-49-45-32(92-61(93-45)52-51(78-20-79-52)60(72,27(8)64)28(9)91-61)19-77-56(49)89-57-48(76-14)39(68)44(31(83-57)18-73-11)88-55-40(69)47(43(74-12)24(5)82-55)85-34-17-58(10)50(26(7)81-34)94-59(95-58)16-30(66)42(25(6)90-59)84-33-15-29(65)41(23(4)80-33)86-54(71)35-22(3)36(62)38(67)37(63)46(35)75-13/h21,23-26,28-34,39-45,47-52,55-57,65-69,72H,15-20H2,1-14H3/t23-,24-,25-,26-,28-,29-,30-,31-,32+,33+,34+,39+,40-,41-,42-,43+,44-,45-,47-,48+,49-,50-,51-,52-,55+,56?,57+,58-,59?,60+,61-/m1/s1 |
| InChI Key | XIRGHRXBGGPPKY-OTPQUNEMSA-N |
| Popularity | 278 references in papers |
| Molecular Formula | C61H88Cl2O32 |
| Molecular Weight | 1404.20 g/mol |
| Exact Mass | 1402.4635760 g/mol |
| Topological Polar Surface Area (TPSA) | 385.00 Ų |
| XlogP | 0.60 |
| Atomic LogP (AlogP) | 1.05 |
| H-Bond Acceptor | 32 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 18 |
| Avilamycina |
| Avilamycine |
| Avilamycinum |
| 11051-71-1 |
| LY 048 740 |
| DTXSID40891398 |
| 720WDX56D3 |
| avilamicina |
| Inteprity |
| Kavault |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9629 | 96.29% |
| Caco-2 | - | 0.8590 | 85.90% |
| Blood Brain Barrier | + | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.5982 | 59.82% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7941 | 79.41% |
| OATP1B3 inhibitior | + | 0.8956 | 89.56% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.9396 | 93.96% |
| P-glycoprotein inhibitior | + | 0.7436 | 74.36% |
| P-glycoprotein substrate | + | 0.8298 | 82.98% |
| CYP3A4 substrate | + | 0.7644 | 76.44% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8674 | 86.74% |
| CYP3A4 inhibition | + | 0.5893 | 58.93% |
| CYP2C9 inhibition | - | 0.6791 | 67.91% |
| CYP2C19 inhibition | - | 0.6556 | 65.56% |
| CYP2D6 inhibition | - | 0.8206 | 82.06% |
| CYP1A2 inhibition | - | 0.7569 | 75.69% |
| CYP2C8 inhibition | + | 0.8361 | 83.61% |
| CYP inhibitory promiscuity | - | 0.5211 | 52.11% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.7838 | 78.38% |
| Carcinogenicity (trinary) | Danger | 0.4251 | 42.51% |
| Eye corrosion | - | 0.9846 | 98.46% |
| Eye irritation | - | 0.8972 | 89.72% |
| Skin irritation | - | 0.7845 | 78.45% |
| Skin corrosion | - | 0.9208 | 92.08% |
| Ames mutagenesis | + | 0.5400 | 54.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7334 | 73.34% |
| Micronuclear | - | 0.5800 | 58.00% |
| Hepatotoxicity | + | 0.5925 | 59.25% |
| skin sensitisation | - | 0.8098 | 80.98% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.8488 | 84.88% |
| Acute Oral Toxicity (c) | III | 0.4944 | 49.44% |
| Estrogen receptor binding | + | 0.7417 | 74.17% |
| Androgen receptor binding | + | 0.7587 | 75.87% |
| Thyroid receptor binding | + | 0.6507 | 65.07% |
| Glucocorticoid receptor binding | + | 0.7964 | 79.64% |
| Aromatase binding | + | 0.6996 | 69.96% |
| PPAR gamma | + | 0.8100 | 81.00% |
| Honey bee toxicity | - | 0.6124 | 61.24% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.9699 | 96.99% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.88% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.57% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.77% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 96.31% | 91.19% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 95.72% | 98.75% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.63% | 96.77% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.31% | 85.14% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.86% | 95.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.27% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.67% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.64% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.46% | 97.25% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.89% | 96.90% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.47% | 94.00% |
| CHEMBL3572 | P11597 | Cholesteryl ester transfer protein | 90.27% | 92.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.15% | 96.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.04% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.85% | 94.73% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.17% | 92.62% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.01% | 92.29% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.94% | 97.21% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 86.44% | 95.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.96% | 91.07% |
| CHEMBL204 | P00734 | Thrombin | 85.96% | 96.01% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.10% | 85.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.88% | 93.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.43% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.38% | 86.33% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.44% | 95.64% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.37% | 94.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.29% | 98.95% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.14% | 96.43% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.83% | 97.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.66% | 96.47% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.84% | 92.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.74% | 95.93% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.65% | 96.21% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.44% | 90.93% |
| CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 81.27% | 95.44% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.90% | 94.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.63% | 92.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.51% | 96.61% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.20% | 90.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.04% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71674 |
| LOTUS | LTS0118017 |
| wikiData | Q29463703 |