Aversin
| Internal ID | bc78238a-4b05-40f8-b74d-65b58f5dd60b |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | (4S,8R)-18-hydroxy-2,16-dimethoxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14(19),15,17-hexaene-13,20-dione |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)O)C(=O)C3=C(C4=C(C=C3C2=O)OC5C4CCO5)OC |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)O)C(=O)C3=C(C4=C(C=C3C2=O)O[C@@H]5[C@H]4CCO5)OC |
| InChI | InChI=1S/C20H16O7/c1-24-8-5-10-14(12(21)6-8)18(23)16-11(17(10)22)7-13-15(19(16)25-2)9-3-4-26-20(9)27-13/h5-7,9,20-21H,3-4H2,1-2H3/t9-,20+/m0/s1 |
| InChI Key | RJMVOYLRGJZYAO-GWNMQOMSSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.08960285 g/mol |
| Topological Polar Surface Area (TPSA) | 91.30 Ų |
| XlogP | 3.00 |
| (-)-Aversin |
| 34080-91-6 |
| OCJ5M677TN |
| UNII-OCJ5M677TN |
| Anthra(2,3-b)furo(3,2-d)furan-5,10-dione, 2,3,3a,12a-tetrahydro-6-hydroxy-4,8-dimethoxy-, (3aS-cis)- |
| (3aS-cis)-2,3,3a,12a-Tetrahydro-6-hydroxy-4,8-dimethoxyanthra(2,3-b)furo(3,2-d)furan-5,10-dione |
| 2,3,3a,12a-Tetrahydro-6-hydroxy-4,8-dimethoxyanthra(2,3-b)furo(3,2-d)furan-5,10-dione (3aS-cis)- |
| AKOS040750649 |
| (4S,8R)-18-hydroxy-2,16-dimethoxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14(19),15,17-hexaene-13,20-dione |
| ANTHRA(2,3-B)FURO(3,2-D)FURAN-5,10-DIONE, 2,3,3A,12A-TETRAHYDRO-6-HYDROXY-4,8-DIMETHOXY-, (3AS,12AR)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.31% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.47% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.87% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.62% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.52% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.42% | 85.14% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 90.70% | 82.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.39% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.24% | 90.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.23% | 93.40% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.65% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.58% | 92.94% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.95% | 96.38% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.34% | 92.68% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.13% | 94.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.45% | 95.93% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.39% | 95.53% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.15% | 97.14% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.46% | 96.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.40% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.07% | 92.62% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.75% | 96.09% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.56% | 96.12% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.53% | 99.18% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.72% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 22296216 |
| LOTUS | LTS0085934 |
| wikiData | Q105237587 |