Australigenin
Internal ID | 25a5f1aa-cc81-4f26-b12a-61b0572a171a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2S,4S,6R,7S,8R,9S,12S,13S,14R,16R,18S)-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-14,16-diol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(C(CC(C5)O)O)C)C)OC16CCC(=C)CO6 |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@@H]5[C@@]4([C@@H](C[C@@H](C5)O)O)C)C)O[C@]16CCC(=C)CO6 |
InChI | InChI=1S/C27H42O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)13-21-19-6-5-17-11-18(28)12-23(29)26(17,4)20(19)8-9-25(21,24)3/h16-24,28-29H,1,5-14H2,2-4H3/t16-,17-,18+,19+,20-,21-,22-,23+,24-,25-,26-,27+/m0/s1 |
InChI Key | XLHFBXMTUNORSV-XLVIIDFLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H42O4 |
Molecular Weight | 430.60 g/mol |
Exact Mass | 430.30830982 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 4.90 |
90865-22-8 |
5alpha-spirost-25(27)-en-1beta,3beta-diol |
DTXSID10920109 |
CHEBI:178588 |
Spirost-25(27)-en-1,3-diol |
LMST01080049 |
Spirost-25(27)-ene-1,3-diol, (1beta,3beta,5alpha)- |
(1S,2S,4S,6R,7S,8R,9S,12S,13S,14R,16R,18S)-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-14,16-diol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.90% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.12% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.66% | 98.10% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.88% | 89.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.40% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.21% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.93% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.24% | 93.04% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.67% | 95.38% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.49% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.41% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.25% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cordyline australis |
PubChem | 176535 |
LOTUS | LTS0198784 |
wikiData | Q76084449 |