Austalide F
| Internal ID | 4e41f91f-7c0e-44c0-ba5f-a7497dbf169a |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes |
| IUPAC Name | (1R,2R,4S,16R,17S,18R,20S)-2,18-dihydroxy-13,20-dimethoxy-4,7,17,22,22-pentamethyl-5,10,21,23-tetraoxahexacyclo[18.2.1.01,17.04,16.06,14.08,12]tricosa-6(14),7,12-trien-11-one |
| SMILES (Canonical) | CC1=C2COC(=O)C2=C(C3=C1OC4(CC(C56C(OC(O5)(CC(C6(C4C3)C)O)OC)(C)C)O)C)OC |
| SMILES (Isomeric) | CC1=C2COC(=O)C2=C(C3=C1O[C@]4(C[C@H]([C@@]56[C@@]([C@H]4C3)([C@@H](C[C@@](O5)(OC6(C)C)OC)O)C)O)C)OC |
| InChI | InChI=1S/C26H34O9/c1-12-14-11-32-21(29)18(14)20(30-6)13-8-15-23(4,33-19(12)13)9-17(28)26-22(2,3)34-25(31-7,35-26)10-16(27)24(15,26)5/h15-17,27-28H,8-11H2,1-7H3/t15-,16+,17+,23-,24-,25-,26+/m0/s1 |
| InChI Key | UHBMKIHOBUKYRH-BXYHISHMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.22028266 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 1.80 |
| 81543-06-8 |
| 625565FO51 |
| 5H-3,5a-Epoxy-12H-furo(3,4-i)oxepino(4,3-a)xanthen-12-one, 1,2,3,6,7,7a,10,14,14a,14b-decahydro-1,6-dihydroxy-3,13-dimethoxy-5,5,7a,9,14b-pentamethyl-, (1R,3S,5aR,6R,7aS,14aR,14bS)- |
| DTXSID701098899 |
| UNII-625565FO51 |
| (1R,3S,5aR,6R,7aS,14aR,14bS)-1,2,3,6,7,7a,10,14,14a,14b-Decahydro-1,6-dihydroxy-3,13-dimethoxy-5,5,7a,9,14b-pentamethyl-5H-3,5a-epoxy-12H-furo[3,4-i]oxepino[4,3-a]xanthen-12-one |
| 12H-3,5A-EPOXY-5H-FURO(3,4-I)OXEPINO(4,3-A)XANTHEN-12-ONE, 1,2,3,6,7,7A,10,14,14A,14B-DECAHYDRO-1,6-DIHYDROXY-3,13-DIMETHOXY-5,5,7A,9,14B-PENTAMETHYL-, (1R-(1.ALPHA.,3.BETA.,5A.BETA.,6.ALPHA.,7A.BETA.,14A.BETA.,14B.ALPHA.))- |
| 12H-3,5a-Epoxy-5H-furo(3,4-i)oxepino(4,3-a)xanthen-12-one, 1,2,3,6,7,7a,10,14,14a,14b-decahydro-1,6-dihydroxy-3,13-dimethoxy-5,5,7a,9,14b-pentamethyl-, (1R-(1alpha,3beta,5abeta,6alpha,7abeta,14abeta,14balpha))- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.50% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.82% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.86% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.96% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.32% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.74% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.37% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.80% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.20% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.00% | 97.14% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.23% | 93.56% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.25% | 96.43% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.60% | 96.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.28% | 92.62% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.11% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102060448 |
| LOTUS | LTS0127287 |
| wikiData | Q105272694 |