Aureochaeglobosin A
| Internal ID | 5f9f2bd4-50f6-445d-ab0d-835ccfe25d96 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | (1R,3S,7R,8S,10R,11E,13S,15E,17R,18S,20R,21S,22R,23S)-10-hydroxy-7-[(2R,3S,4R)-3-hydroxy-4-[(1E,3E)-penta-1,3-dienyl]oxolan-2-yl]-23-(1H-indol-3-ylmethyl)-11,13,20,21-tetramethyl-19-oxa-24-azapentacyclo[15.8.0.01,22.03,8.018,20]pentacosa-5,11,15-triene-2,9,25-trione |
| SMILES (Canonical) | CC=CC=CC1COC(C1O)C2C=CCC3C2C(=O)C(C(=CC(CC=CC4C5C(O5)(C(C6C4(C3=O)C(=O)NC6CC7=CNC8=CC=CC=C87)C)C)C)C)O |
| SMILES (Isomeric) | C/C=C/C=C/[C@@H]1CO[C@@H]([C@H]1O)[C@@H]2C=CC[C@H]3[C@H]2C(=O)[C@@H](/C(=C/[C@H](C/C=C/[C@H]4[C@H]5[C@](O5)([C@H]([C@@H]6[C@@]4(C3=O)C(=O)N[C@H]6CC7=CNC8=CC=CC=C87)C)C)C)/C)O |
| InChI | InChI=1S/C45H54N2O7/c1-6-7-8-14-27-23-53-40(38(27)49)30-16-12-17-31-35(30)39(50)37(48)25(3)20-24(2)13-11-18-32-42-44(5,54-42)26(4)36-34(47-43(52)45(32,36)41(31)51)21-28-22-46-33-19-10-9-15-29(28)33/h6-12,14-16,18-20,22,24,26-27,30-32,34-38,40,42,46,48-49H,13,17,21,23H2,1-5H3,(H,47,52)/b7-6+,14-8+,18-11+,25-20+/t24-,26-,27+,30+,31-,32-,34-,35-,36-,37+,38-,40+,42-,44+,45-/m0/s1 |
| InChI Key | WAKBAVPLHLJHKP-UBZNKHGNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C45H54N2O7 |
| Molecular Weight | 734.90 g/mol |
| Exact Mass | 734.39310207 g/mol |
| Topological Polar Surface Area (TPSA) | 141.00 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.84% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.25% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.01% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.58% | 99.23% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.29% | 88.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.20% | 96.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.03% | 92.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.76% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.90% | 100.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.49% | 95.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.47% | 94.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.11% | 98.59% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.97% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.05% | 94.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.20% | 96.90% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.94% | 97.09% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.17% | 96.25% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 81.94% | 96.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.90% | 95.71% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.71% | 91.38% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.29% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.11% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.99% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.42% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.27% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591147 |
| LOTUS | LTS0199621 |
| wikiData | Q105300276 |