Aurantin b
| Internal ID | b406402b-556d-42a9-b07c-1d2d90765107 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Hydroxyeicosatrienoic acids |
| IUPAC Name | (7E,9E,11E)-12-[(1Z,6Z)-16-[(2S,3R,5S,6S)-3,5-dihydroxy-6-methyl-4-oxooxan-2-yl]oxy-4-hydroxy-3,7,15,19-tetramethyl-8,10-dioxo-9-oxatetracyclo[9.9.0.02,6.012,17]icosa-1,6,18-trien-20-yl]-3-hydroxy-2,5,7-trimethyldodeca-7,9,11-trienoic acid |
| SMILES (Canonical) | CC1CCC2C(C1OC3C(C(=O)C(C(O3)C)O)O)C=C(C(C4=C5C(C(CC5=C(C(=O)OC(=O)C24)C)O)C)C=CC=CC=C(C)CC(C)CC(C(C)C(=O)O)O)C |
| SMILES (Isomeric) | C[C@H]1[C@@H](C(=O)[C@@H]([C@H](O1)OC2C(CCC3C2C=C(C(/C/4=C/5\C(C(C\C5=C(\C(=O)OC(=O)C34)/C)O)C)/C=C/C=C/C=C(\C)/CC(C)CC(C(C)C(=O)O)O)C)C)O)O |
| InChI | InChI=1S/C44H60O12/c1-20(16-21(2)17-32(45)26(7)41(50)51)12-10-9-11-13-28-23(4)18-31-29(15-14-22(3)40(31)55-44-39(49)38(48)37(47)27(8)54-44)36-35(28)34-25(6)33(46)19-30(34)24(5)42(52)56-43(36)53/h9-13,18,21-22,25-29,31-33,36-37,39-40,44-47,49H,14-17,19H2,1-8H3,(H,50,51)/b10-9+,13-11+,20-12+,30-24-,35-34-/t21?,22?,25?,26?,27-,28?,29?,31?,32?,33?,36?,37-,39-,40?,44+/m0/s1 |
| InChI Key | MPPYMLNQFAPEHU-WICFQGSQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C44H60O12 |
| Molecular Weight | 780.90 g/mol |
| Exact Mass | 780.40847734 g/mol |
| Topological Polar Surface Area (TPSA) | 197.00 Ų |
| XlogP | 4.50 |
| (7E,9E,11E)-12-[(1Z,6Z)-16-[(2S,3R,5S,6S)-3,5-Dihydroxy-6-methyl-4-oxooxan-2-yl]oxy-4-hydroxy-3,7,15,19-tetramethyl-8,10-dioxo-9-oxatetracyclo[9.9.0.02,6.012,17]icosa-1,6,18-trien-20-yl]-3-hydroxy-2,5,7-trimethyldodeca-7,9,11-trienoic acid |
| (7E,9E,11E)-12-((1Z,6Z)-16-((2S,3R,5S,6S)-3,5-dihydroxy-6-methyl-4-oxooxan-2-yl)oxy-4-hydroxy-3,7,15,19-tetramethyl-8,10-dioxo-9-oxatetracyclo(9.9.0.02,6.012,17)icosa-1,6,18-trien-20-yl)-3-hydroxy-2,5,7-trimethyldodeca-7,9,11-trienoic acid |
| 97707-52-3 |
| RefChem:916486 |
| DTXCID201526439 |
| 7,9,11-Dodecatrienoic acid, 12-(1-((6-deoxy-beta-D-ribo-hexopyranos-3-ulos-1-yl)oxy)-2,3,4,4a,4b,5,7,9,10,11,12,14a-dodecahydro-10-hydroxy-2,8,11,13-tetramethyl-5,7-dioxo-1H-benzo(6,7)cyclohepta(1,2-c)cyclopent(e)oxocin-12-yl)-3-hydroxy-2,5,7-trimethyl- |
| DTXSID901044000 |
| aurantin b |
| CHEBI:223717 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.98% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.11% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.45% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.99% | 89.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.37% | 93.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.57% | 86.33% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.51% | 97.36% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.71% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.25% | 95.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.08% | 96.47% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.34% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.47% | 99.23% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.91% | 91.19% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.15% | 98.75% |
| CHEMBL5028 | O14672 | ADAM10 | 82.70% | 97.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.79% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.54% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14080749 |
| LOTUS | LTS0123543 |
| wikiData | Q77572975 |