Astragaloside II
Internal ID | 4dc2dd34-b833-40e8-a5c2-5c13ca5b06b6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [(2S,3R,4S,5R)-4,5-dihydroxy-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-14-hydroxy-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxan-3-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C(C(COC1OC2CCC34CC35CCC6(C(C(CC6(C5CC(C4C2(C)C)OC7C(C(C(C(O7)CO)O)O)O)C)O)C8(CCC(O8)C(C)(C)O)C)C)O)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H]([C@@H](CO[C@H]1O[C@H]2CC[C@]34C[C@]35CC[C@@]6([C@H]([C@H](C[C@]6([C@@H]5C[C@@H]([C@H]4C2(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)O)[C@]8(CC[C@H](O8)C(C)(C)O)C)C)O)O |
InChI | InChI=1S/C43H70O15/c1-20(45)54-32-28(48)22(47)18-53-36(32)57-26-10-12-43-19-42(43)14-13-39(6)33(41(8)11-9-27(58-41)38(4,5)52)21(46)16-40(39,7)25(42)15-23(34(43)37(26,2)3)55-35-31(51)30(50)29(49)24(17-44)56-35/h21-36,44,46-52H,9-19H2,1-8H3/t21-,22+,23-,24+,25-,26-,27-,28-,29+,30-,31+,32+,33-,34-,35+,36-,39+,40-,41+,42-,43+/m0/s1 |
InChI Key | AYWNHWGQTMCQIV-PENCHUSISA-N |
Popularity | 16 references in papers |
Molecular Formula | C43H70O15 |
Molecular Weight | 827.00 g/mol |
Exact Mass | 826.47147152 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | 1.80 |
Atomic LogP (AlogP) | 1.29 |
H-Bond Acceptor | 15 |
H-Bond Donor | 8 |
Rotatable Bonds | 8 |
Astrasieversianin VIII |
UNII-0K5J34DHEN |
NSC-641295 |
0K5J34DHEN |
91739-01-4 |
CHEBI:91026 |
[(2S,3R,4S,5R)-4,5-dihydroxy-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-14-hydroxy-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxan-3-yl] acetate |
Astragaloside II (constituent of astragalus) [DSC] |
AstragalosideII |
(3beta,6alpha,9beta,16beta,20R,24S)-3-((2-O-acetyl-beta-D-xylopyranosyl)oxy)-16,25-dihydroxy-20,24-epoxy-9,19-cyclolanostan-6-yl beta-D-glucopyranoside |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7317 | 73.17% |
Caco-2 | - | 0.8805 | 88.05% |
Blood Brain Barrier | - | 0.7000 | 70.00% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.7562 | 75.62% |
OATP2B1 inhibitior | - | 0.8722 | 87.22% |
OATP1B1 inhibitior | + | 0.8162 | 81.62% |
OATP1B3 inhibitior | + | 0.9373 | 93.73% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.7037 | 70.37% |
BSEP inhibitior | - | 0.5993 | 59.93% |
P-glycoprotein inhibitior | + | 0.7721 | 77.21% |
P-glycoprotein substrate | + | 0.5482 | 54.82% |
CYP3A4 substrate | + | 0.7414 | 74.14% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8835 | 88.35% |
CYP3A4 inhibition | - | 0.8287 | 82.87% |
CYP2C9 inhibition | - | 0.7944 | 79.44% |
CYP2C19 inhibition | - | 0.8434 | 84.34% |
CYP2D6 inhibition | - | 0.9423 | 94.23% |
CYP1A2 inhibition | - | 0.9013 | 90.13% |
CYP2C8 inhibition | + | 0.6983 | 69.83% |
CYP inhibitory promiscuity | - | 0.9446 | 94.46% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6529 | 65.29% |
Eye corrosion | - | 0.9889 | 98.89% |
Eye irritation | - | 0.9084 | 90.84% |
Skin irritation | - | 0.7042 | 70.42% |
Skin corrosion | - | 0.9414 | 94.14% |
Ames mutagenesis | - | 0.6070 | 60.70% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7576 | 75.76% |
Micronuclear | - | 0.7700 | 77.00% |
Hepatotoxicity | - | 0.6675 | 66.75% |
skin sensitisation | - | 0.9104 | 91.04% |
Respiratory toxicity | + | 0.5778 | 57.78% |
Reproductive toxicity | + | 0.7333 | 73.33% |
Mitochondrial toxicity | - | 0.5625 | 56.25% |
Nephrotoxicity | - | 0.9435 | 94.35% |
Acute Oral Toxicity (c) | I | 0.6348 | 63.48% |
Estrogen receptor binding | + | 0.6505 | 65.05% |
Androgen receptor binding | + | 0.7421 | 74.21% |
Thyroid receptor binding | - | 0.5907 | 59.07% |
Glucocorticoid receptor binding | + | 0.6987 | 69.87% |
Aromatase binding | + | 0.6831 | 68.31% |
PPAR gamma | + | 0.7540 | 75.40% |
Honey bee toxicity | - | 0.6071 | 60.71% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.9017 | 90.17% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.56% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.43% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.81% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.43% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.80% | 96.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.39% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.46% | 97.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.30% | 91.24% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.91% | 96.21% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.79% | 96.61% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.63% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.42% | 83.57% |
CHEMBL220 | P22303 | Acetylcholinesterase | 87.99% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.45% | 89.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.22% | 82.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.99% | 95.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.47% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.90% | 91.19% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.77% | 100.00% |
CHEMBL204 | P00734 | Thrombin | 85.73% | 96.01% |
CHEMBL2581 | P07339 | Cathepsin D | 85.19% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.77% | 95.93% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.55% | 95.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.44% | 91.07% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.33% | 92.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.79% | 92.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.77% | 95.71% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.95% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.90% | 97.14% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.65% | 92.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.60% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.46% | 95.89% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.27% | 92.88% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.15% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus condensatus |
Astragalus exilis |
Astragalus microcephalus |
Astragalus mongholicus |
Astragalus oleifolius |
Astragalus sieversianus |
Astragalus trimestris |
Euphorbia glareosa |
Waltheria communis |
PubChem | 13996693 |
NPASS | NPC108227 |
LOTUS | LTS0182668 |
wikiData | Q27163026 |