astin B
Internal ID | d6f7b275-51a9-4ba0-95ae-a138de76449c |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
IUPAC Name | 17,18-dichloro-3-ethyl-13-(1-hydroxyethyl)-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
SMILES (Canonical) | CCC1C(=O)N2CC(C(C2C(=O)NC(C(=O)NC(C(=O)NC(CC(=O)N1)C3=CC=CC=C3)CO)C(C)O)Cl)Cl |
SMILES (Isomeric) | CCC1C(=O)N2CC(C(C2C(=O)NC(C(=O)NC(C(=O)NC(CC(=O)N1)C3=CC=CC=C3)CO)C(C)O)Cl)Cl |
InChI | InChI=1S/C25H33Cl2N5O7/c1-3-15-25(39)32-10-14(26)19(27)21(32)24(38)31-20(12(2)34)23(37)30-17(11-33)22(36)29-16(9-18(35)28-15)13-7-5-4-6-8-13/h4-8,12,14-17,19-21,33-34H,3,9-11H2,1-2H3,(H,28,35)(H,29,36)(H,30,37)(H,31,38) |
InChI Key | DQILVZOWLYBPKT-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C25H33Cl2N5O7 |
Molecular Weight | 586.50 g/mol |
Exact Mass | 585.1757038 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 0.60 |
151201-76-2 |
17,18-dichloro-3-ethyl-13-(1-hydroxyethyl)-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
AKOS040761383 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.18% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.90% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.79% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.35% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.39% | 97.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.11% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.20% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.66% | 93.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.88% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.94% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.23% | 95.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.84% | 96.47% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.78% | 97.14% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.97% | 97.64% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.75% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aster tataricus |
PubChem | 15233655 |
LOTUS | LTS0070211 |
wikiData | Q104986977 |