Aspernolide G
| Internal ID | 5fb31e5a-116f-48f2-8452-a340ff11c4f8 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters |
| IUPAC Name | methyl (2R)-2-[[3-[(2S)-2,3-dihydroxy-3-methylbutyl]-4-hydroxyphenyl]methyl]-4-ethoxy-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate |
| SMILES (Canonical) | CCOC1=C(C(OC1=O)(CC2=CC(=C(C=C2)O)CC(C(C)(C)O)O)C(=O)OC)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | CCOC1=C([C@](OC1=O)(CC2=CC(=C(C=C2)O)C[C@@H](C(C)(C)O)O)C(=O)OC)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C26H30O9/c1-5-34-22-21(16-7-9-18(27)10-8-16)26(24(31)33-4,35-23(22)30)14-15-6-11-19(28)17(12-15)13-20(29)25(2,3)32/h6-12,20,27-29,32H,5,13-14H2,1-4H3/t20-,26+/m0/s1 |
| InChI Key | QUSUCMRGJBZSBW-RXFWQSSRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.18898253 g/mol |
| Topological Polar Surface Area (TPSA) | 143.00 Ų |
| XlogP | 2.70 |
| methyl (2R)-4-ethoxy-2-((3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)methyl)-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate |
| methyl (2R)-4-ethoxy-2-[(3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)methyl]-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate |
| RefChem:114986 |
| CHEBI:220980 |
| methyl (2R)-2-[[3-[(2S)-2,3-dihydroxy-3-methylbutyl]-4-hydroxyphenyl]methyl]-4-ethoxy-3-(4-hydroxyphenyl)-5-oxouran-2-carboxylate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.36% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.20% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.84% | 85.14% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.70% | 95.17% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 95.76% | 90.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.60% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.24% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.11% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.09% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.89% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.86% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.39% | 86.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.73% | 83.82% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.56% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.14% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.44% | 99.15% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.95% | 96.95% |
| CHEMBL1944 | P08473 | Neprilysin | 85.47% | 92.63% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.99% | 93.65% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.94% | 97.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.84% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.64% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.57% | 92.62% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.09% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132556698 |
| LOTUS | LTS0078209 |
| wikiData | Q77505110 |