Asperidine C
Internal ID | 99f2cfae-0f9f-4123-b154-9558c6221078 |
Taxonomy | Organoheterocyclic compounds > Azolidines > Isoxazolidines > Phenylisoxazolidines |
IUPAC Name | (2R,4S,5R,6S)-2-nonyl-6-phenyl-7-oxa-1-azabicyclo[3.2.1]octan-4-ol |
SMILES (Canonical) | CCCCCCCCCC1CC(C2CN1OC2C3=CC=CC=C3)O |
SMILES (Isomeric) | CCCCCCCCC[C@@H]1C[C@@H]([C@H]2CN1O[C@@H]2C3=CC=CC=C3)O |
InChI | InChI=1S/C21H33NO2/c1-2-3-4-5-6-7-11-14-18-15-20(23)19-16-22(18)24-21(19)17-12-9-8-10-13-17/h8-10,12-13,18-21,23H,2-7,11,14-16H2,1H3/t18-,19-,20+,21-/m1/s1 |
InChI Key | ZEKACHFYLSYPOC-MXEMCNAFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H33NO2 |
Molecular Weight | 331.50 g/mol |
Exact Mass | 331.251129295 g/mol |
Topological Polar Surface Area (TPSA) | 32.70 Ų |
XlogP | 5.90 |
Asperidine C |
BDBM50463448 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.54% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.12% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.49% | 92.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.08% | 90.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.27% | 93.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.25% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.93% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.26% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.28% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.17% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.92% | 93.99% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 83.56% | 91.81% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.52% | 99.17% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.69% | 94.08% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.52% | 89.63% |
CHEMBL3891 | P07384 | Calpain 1 | 80.37% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus japonica |
Psiadia punctulata |
PubChem | 145985497 |
LOTUS | LTS0084789 |
wikiData | Q105112738 |